2,6-Dimethyltyrosine HCl structure
|
Common Name | 2,6-Dimethyltyrosine HCl | ||
|---|---|---|---|---|
| CAS Number | 80110-73-2 | Molecular Weight | 245.703 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2,6-Dimethyltyrosine HCl2,6-DiMethyltyrosine HCl is a tyrosine derivative[1]. |
| Name | 2-amino-3-(4-hydroxy-2,6-dimethylphenyl)propanoic acid,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | 2,6-DiMethyltyrosine HCl is a tyrosine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Molecular Formula | C11H16ClNO3 |
|---|---|
| Molecular Weight | 245.703 |
| Exact Mass | 245.081863 |
| PSA | 83.55000 |
| LogP | 2.46570 |
| InChIKey | WEZPIGXFXWUCDS-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)cc(C)c1CC(N)C(=O)O.Cl |
| 2,6-Dimethyl-L-tyrosine hydrochloride (1:1) |
| L-Tyrosine, 2,6-dimethyl-, hydrochloride (1:1) |
| (S)-2-Amino-3-(4-hydroxy-2,6-dimethyl-phenyl)-propionic acid HCl |
| 2,6-Dimethyl-L-tyrosine hydrochloride |
| DL-Tyrosine,2,6-dimethyl-,hydrochloride |