methyl 6-bromo-2,3,4-trimethoxybenzoate structure
|
Common Name | methyl 6-bromo-2,3,4-trimethoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 80141-07-7 | Molecular Weight | 305.12200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13BrO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 6-bromo-2,3,4-trimethoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H13BrO5 |
|---|---|
| Molecular Weight | 305.12200 |
| Exact Mass | 303.99500 |
| PSA | 53.99000 |
| LogP | 2.26150 |
| InChIKey | FLJQTUJPNBCMPJ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(Br)cc(OC)c(OC)c1OC |
| HS Code | 2918990090 |
|---|
|
~88%
methyl 6-bromo-... CAS#:80141-07-7 |
| Literature: Sargent, Melvyn V. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1987 , p. 2553 - 2564 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzoic acid,6-bromo-2,3,4-trimethoxy-,methyl ester |