Trichothec-9-ene-3,4,15-triol, 12,13-epoxy-, 4-(chloroacetate), (3.alpha.,4.beta.)- structure
|
Common Name | Trichothec-9-ene-3,4,15-triol, 12,13-epoxy-, 4-(chloroacetate), (3.alpha.,4.beta.)- | ||
|---|---|---|---|---|
| CAS Number | 80178-17-2 | Molecular Weight | 358.81400 | |
| Density | 1.424g/cm3 | Boiling Point | 497.652ºC at 760 mmHg | |
| Molecular Formula | C17H23ClO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.771ºC | |
| Name | 4β-(chloroacetoxy)scirpene-3α,15-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.424g/cm3 |
|---|---|
| Boiling Point | 497.652ºC at 760 mmHg |
| Molecular Formula | C17H23ClO6 |
| Molecular Weight | 358.81400 |
| Flash Point | 254.771ºC |
| Exact Mass | 358.11800 |
| PSA | 88.52000 |
| LogP | 0.77300 |
| Index of Refraction | 1.594 |
| InChIKey | NKCJHBQJGPSCTL-RHEXVZGZSA-N |
| SMILES | CC1=CC2OC3C(O)C(OC(=O)CCl)C(C)(C2(CO)CC1)C31CO1 |
|
~2%
Trichothec-9-en... CAS#:80178-17-2
Detail
|
| Literature: Kaneko; Schmitz; Essery; Rose; Howell; O'Herron; Nachfolger; Huftalen; Bradner; Partyka; Doyle; Davies; Cundliffe Journal of Medicinal Chemistry, 1982 , vol. 25, # 5 p. 579 - 589 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| anguidine deriv 4-chloroacetylscirpene-3,15-diol |