Phenol,2,2'-methylenebis[6-chloro-4-(1,1-dimethylethyl)- structure
|
Common Name | Phenol,2,2'-methylenebis[6-chloro-4-(1,1-dimethylethyl)- | ||
|---|---|---|---|---|
| CAS Number | 802-62-0 | Molecular Weight | 381.33600 | |
| Density | 1.18g/cm3 | Boiling Point | 438.4ºC at 760 mmHg | |
| Molecular Formula | C21H26Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219ºC | |
| Name | 4-tert-butyl-2-[(5-tert-butyl-3-chloro-2-hydroxyphenyl)methyl]-6-chlorophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 438.4ºC at 760 mmHg |
| Molecular Formula | C21H26Cl2O2 |
| Molecular Weight | 381.33600 |
| Flash Point | 219ºC |
| Exact Mass | 380.13100 |
| PSA | 40.46000 |
| LogP | 6.59040 |
| Index of Refraction | 1.569 |
| InChIKey | UTLMNROXVKXUNY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(Cl)c(O)c(Cc2cc(C(C)(C)C)cc(Cl)c2O)c1 |
|
~%
Phenol,2,2'-met... CAS#:802-62-0 |
| Literature: Beaver; Stoffel Journal of the American Chemical Society, 1952 , vol. 74, p. 3410 |
|
~%
Phenol,2,2'-met... CAS#:802-62-0 |
| Literature: Kaemmerer,H.; Haberer,K. Monatshefte fuer Chemie, 1964 , vol. 95, p. 1589 - 1598 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4,4'-di-tert-butyl-6,6'-dichloro-2,2'-methanediyl-di-phenol |
| 4,4'-Di-tert-butyl-6,6'-dichlor-2,2'-methandiyl-di-phenol |
| 3,3'-Dichlor-2,2'-dihydroxy-5,5'-di-tert-butyl-diphenylmethan |