2-diethoxyphosphoryl-2-formamidoacetic acid
2-diethoxyphosphoryl-2-formamidoacetic acid structure
|
Common Name | 2-diethoxyphosphoryl-2-formamidoacetic acid | ||
|---|---|---|---|---|
| CAS Number | 80239-41-4 | Molecular Weight | 239.16300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H14NO6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2-Diethoxyphosphoryl-2-formamidoacetic acid, Chinese name: 2-二乙氧膦酰基-2-乙酰胺乙酸, CAS number: 80239-41-4, molecular formula: C7H14NO6P, molecular weight: 239.16300. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-diethoxyphosphoryl-2-formamidoacetic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H14NO6P |
|---|---|
| Molecular Weight | 239.16300 |
| Exact Mass | 239.05600 |
| PSA | 115.23000 |
| LogP | 1.24950 |
| InChIKey | KTZMFPBNVXAKDV-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)C(NC=O)C(=O)O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-diethoxyphosp... CAS#:80239-41-4 |
| Literature: Rachon; Schoellkopf 1981 , vol. No. 9, p. 1693 - 1698 |
|
~%
2-diethoxyphosp... CAS#:80239-41-4 |
| Literature: Rachon; Schoellkopf 1981 , vol. No. 9, p. 1693 - 1698 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Diethoxyphosphinyl-N-formylglycine |
| Acetic acid,(diethoxyphosphinyl)(formylamino) |
| 2-(Diethoxyphosphoryl)-N-formylglycin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-diethoxyphosphoryl-2-formamidoacetic acid? |
| A: CAS number of 2-diethoxyphosphoryl-2-formamidoacetic acid is 80239-41-4. |
| Q: What are the upstream materials of 2-diethoxyphosphoryl-2-formamidoacetic acid? |
| A: Related upstream materials(CAS) of 2-diethoxyphosphoryl-2-formamidoacetic acid: 41003-94-5;80239-43-6. |
| Q: What English synonyms does 2-diethoxyphosphoryl-2-formamidoacetic acid have? |
| A: English synonyms of 2-diethoxyphosphoryl-2-formamidoacetic acid: 2-Diethoxyphosphinyl-N-formylglycine, Acetic acid,(diethoxyphosphinyl)(formylamino), 2-(Diethoxyphosphoryl)-N-formylglycin. |
| Q: What is the English name of 2-diethoxyphosphoryl-2-formamidoacetic acid? |
| A: The English name of 2-diethoxyphosphoryl-2-formamidoacetic acid is 2-diethoxyphosphoryl-2-formamidoacetic acid. |
| Q: What is the molecular formula of 2-diethoxyphosphoryl-2-formamidoacetic acid? |
| A: Molecular formula of 2-diethoxyphosphoryl-2-formamidoacetic acid is C7H14NO6P. |
| Q: What is the Chinese name of 80239-41-4? |
| A: Chinese name of 80239-41-4 is 80239-41-4. |
| Q: What is the InChIKey of 2-diethoxyphosphoryl-2-formamidoacetic acid? |
| A: InChIKey of 2-diethoxyphosphoryl-2-formamidoacetic acid is KTZMFPBNVXAKDV-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 2-diethoxyphosphoryl-2-formamidoacetic acid? |
| A: Polar surface area (PSA) of 2-diethoxyphosphoryl-2-formamidoacetic acid is 115.23000. |
| Q: What is the molecular weight of 2-diethoxyphosphoryl-2-formamidoacetic acid? |
| A: Molecular weight of 2-diethoxyphosphoryl-2-formamidoacetic acid is 239.16300. |
| Q: What is the SMILES notation of 2-diethoxyphosphoryl-2-formamidoacetic acid? |
| A: SMILES notation of 2-diethoxyphosphoryl-2-formamidoacetic acid is CCOP(=O)(OCC)C(NC=O)C(=O)O. |