2-[(3,4-dimethoxyphenyl)methylideneamino]phenol structure
|
Common Name | 2-[(3,4-dimethoxyphenyl)methylideneamino]phenol | ||
|---|---|---|---|---|
| CAS Number | 80241-83-4 | Molecular Weight | 257.28400 | |
| Density | 1.11g/cm3 | Boiling Point | 433.4ºC at 760 mmHg | |
| Molecular Formula | C15H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.9ºC | |
| Name | 2-[(3,4-dimethoxyphenyl)methylideneamino]phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 433.4ºC at 760 mmHg |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.28400 |
| Flash Point | 215.9ºC |
| Exact Mass | 257.10500 |
| PSA | 51.05000 |
| LogP | 3.16000 |
| Index of Refraction | 1.545 |
| InChIKey | CPOKOAWVSUHOCZ-UHFFFAOYSA-N |
| SMILES | COc1ccc(C=Nc2ccccc2O)cc1OC |
|
~99%
2-[(3,4-dimetho... CAS#:80241-83-4 |
| Literature: Rai, Mangat; Kaur, Baljit; Dhir, B. S. Journal of the Indian Chemical Society, 1982 , vol. 59, # 3 p. 416 - 417 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| ipo 3819 |