1-bis(4-methoxyphenyl)phosphoryl-4-methoxybenzene
1-bis(4-methoxyphenyl)phosphoryl-4-methoxybenzene structure
|
Common Name | 1-bis(4-methoxyphenyl)phosphoryl-4-methoxybenzene | ||
|---|---|---|---|---|
| CAS Number | 803-17-8 | Molecular Weight | 368.36300 | |
| Density | 1.22g/cm3 | Boiling Point | 549.4ºC at 760 mmHg | |
| Molecular Formula | C21H21O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 299ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-bis(4-methoxyphenyl)phosphoryl-4-methoxybenzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 549.4ºC at 760 mmHg |
| Molecular Formula | C21H21O4P |
| Molecular Weight | 368.36300 |
| Flash Point | 299ºC |
| Exact Mass | 368.11800 |
| PSA | 54.57000 |
| LogP | 3.35180 |
| Index of Refraction | 1.591 |
| InChIKey | KSTMQPBYFFFVFI-UHFFFAOYSA-N |
| SMILES | COc1ccc(P(=O)(c2ccc(OC)cc2)c2ccc(OC)cc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 2 | |
CAS#:855-38-9
CAS#:104-92-7
CAS#:106-93-4
CAS#:14180-55-3
CAS#:7175-54-4
CAS#:15676-95-6
CAS#:3400-27-9
CAS#:73116-90-2
CAS#:797-71-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Tris(4-methoxyphenyl)phosphine oxide |
| tris(4-methoxyphenyl)phosphane oxide |
| tris(p-methoxyphenyl)phosphine oxide |
| (p-MeOPh)3PO |
| tris(para-methoxyphenyl)phosphine oxide |
| Phosphine oxide,tris(4-methoxyphenyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-bis(4-methoxyphenyl)phosphoryl-4-methoxybenzene? |
| A: Molecular weight of 1-bis(4-methoxyphenyl)phosphoryl-4-methoxybenzene is 368.36300. |
| Q: What are the downstream products of 1-bis(4-methoxyphenyl)phosphoryl-4-methoxybenzene? |
| A: Related downstream products(CAS) of 1-bis(4-methoxyphenyl)phosphoryl-4-methoxybenzene: 855-38-9;797-71-7. |
| Q: What English synonyms does 1-bis(4-methoxyphenyl)phosphoryl-4-methoxybenzene have? |
| A: English synonyms of 1-bis(4-methoxyphenyl)phosphoryl-4-methoxybenzene: Tris(4-methoxyphenyl)phosphine oxide, tris(4-methoxyphenyl)phosphane oxide, tris(p-methoxyphenyl)phosphine oxide, (p-MeOPh)3PO, tris(para-methoxyphenyl)phosphine oxide, Phosphine oxide,tris(4-methoxyphenyl). |
| Q: What is the InChIKey of 1-bis(4-methoxyphenyl)phosphoryl-4-methoxybenzene? |
| A: InChIKey of 1-bis(4-methoxyphenyl)phosphoryl-4-methoxybenzene is KSTMQPBYFFFVFI-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 803-17-8? |
| A: Chinese name of 803-17-8 is 803-17-8. |
| Q: What is the LogP of 1-bis(4-methoxyphenyl)phosphoryl-4-methoxybenzene? |
| A: LogP of 1-bis(4-methoxyphenyl)phosphoryl-4-methoxybenzene is 3.35180. |
| Q: What is the polar surface area (PSA) of 1-bis(4-methoxyphenyl)phosphoryl-4-methoxybenzene? |
| A: Polar surface area (PSA) of 1-bis(4-methoxyphenyl)phosphoryl-4-methoxybenzene is 54.57000. |
| Q: What is the English name of 1-bis(4-methoxyphenyl)phosphoryl-4-methoxybenzene? |
| A: The English name of 1-bis(4-methoxyphenyl)phosphoryl-4-methoxybenzene is 1-bis(4-methoxyphenyl)phosphoryl-4-methoxybenzene. |
| Q: What is the boiling point of 1-bis(4-methoxyphenyl)phosphoryl-4-methoxybenzene? |
| A: Boiling point of 1-bis(4-methoxyphenyl)phosphoryl-4-methoxybenzene is 549.4ºC at 760 mmHg. |
| Q: What are the upstream materials of 1-bis(4-methoxyphenyl)phosphoryl-4-methoxybenzene? |
| A: Related upstream materials(CAS) of 1-bis(4-methoxyphenyl)phosphoryl-4-methoxybenzene: 855-38-9;104-92-7;106-93-4;14180-55-3;7175-54-4;15676-95-6;3400-27-9;73116-90-2. |