6-bromo-2-(4-methoxyphenyl)benzo[h]chromen-4-one
![6-bromo-2-(4-methoxyphenyl)benzo[h]chromen-4-one Structure](https://image.chemsrc.com/caspic/338/80309-04-2.png)
6-bromo-2-(4-methoxyphenyl)benzo[h]chromen-4-one structure
|
Common Name | 6-bromo-2-(4-methoxyphenyl)benzo[h]chromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 80309-04-2 | Molecular Weight | 381.21900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H13BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-bromo-2-(4-methoxyphenyl)benzo[h]chromen-4-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H13BrO3 |
|---|---|
| Molecular Weight | 381.21900 |
| Exact Mass | 380.00500 |
| PSA | 39.44000 |
| LogP | 5.38430 |
| InChIKey | IHSYZBWTKLRNBR-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cc(=O)c3cc(Br)c4ccccc4c3o2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 6-bromo-2-(4-methoxy-phenyl)-benzo[h]chromen-4-one |
| 6-Brom-2-(4-methoxy-phenyl)-benzo[h]chromen-4-on |
| 4H-Naphtho[1,2-b]pyran-4-one,6-bromo-2-(4-methoxyphenyl) |
| 6-bromo-4'-methoxy-7,8-benzoflavanone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 6-bromo-2-(4-methoxyphenyl)benzo[h]chromen-4-one? |
| A: InChIKey of 6-bromo-2-(4-methoxyphenyl)benzo[h]chromen-4-one is IHSYZBWTKLRNBR-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 80309-04-2? |
| A: Chinese name of 80309-04-2 is 80309-04-2. |
| Q: What is the SMILES notation of 6-bromo-2-(4-methoxyphenyl)benzo[h]chromen-4-one? |
| A: SMILES notation of 6-bromo-2-(4-methoxyphenyl)benzo[h]chromen-4-one is COc1ccc(-c2cc(=O)c3cc(Br)c4ccccc4c3o2)cc1. |
| Q: What is the molecular weight of 6-bromo-2-(4-methoxyphenyl)benzo[h]chromen-4-one? |
| A: Molecular weight of 6-bromo-2-(4-methoxyphenyl)benzo[h]chromen-4-one is 381.21900. |
| Q: What is the molecular formula of 6-bromo-2-(4-methoxyphenyl)benzo[h]chromen-4-one? |
| A: Molecular formula of 6-bromo-2-(4-methoxyphenyl)benzo[h]chromen-4-one is C20H13BrO3. |
| Q: What is the LogP of 6-bromo-2-(4-methoxyphenyl)benzo[h]chromen-4-one? |
| A: LogP of 6-bromo-2-(4-methoxyphenyl)benzo[h]chromen-4-one is 5.38430. |
| Q: What is the CAS number of 6-bromo-2-(4-methoxyphenyl)benzo[h]chromen-4-one? |
| A: CAS number of 6-bromo-2-(4-methoxyphenyl)benzo[h]chromen-4-one is 80309-04-2. |
| Q: What is the English name of 6-bromo-2-(4-methoxyphenyl)benzo[h]chromen-4-one? |
| A: The English name of 6-bromo-2-(4-methoxyphenyl)benzo[h]chromen-4-one is 6-bromo-2-(4-methoxyphenyl)benzo[h]chromen-4-one. |
| Q: What are the upstream materials of 6-bromo-2-(4-methoxyphenyl)benzo[h]chromen-4-one? |
| A: Related upstream materials(CAS) of 6-bromo-2-(4-methoxyphenyl)benzo[h]chromen-4-one: 711-79-5;52220-64-1;623-11-0;30508-15-7;67-64-1. |
| Q: What English synonyms does 6-bromo-2-(4-methoxyphenyl)benzo[h]chromen-4-one have? |
| A: English synonyms of 6-bromo-2-(4-methoxyphenyl)benzo[h]chromen-4-one: 6-bromo-2-(4-methoxy-phenyl)-benzo[h]chromen-4-one, 6-Brom-2-(4-methoxy-phenyl)-benzo[h]chromen-4-on, 4H-Naphtho[1,2-b]pyran-4-one,6-bromo-2-(4-methoxyphenyl), 6-bromo-4'-methoxy-7,8-benzoflavanone. |