(4R)-4-[2-(benzenesulfonyl)ethyl]-2,2,4-trimethyl-1,3-dioxolane
![(4R)-4-[2-(benzenesulfonyl)ethyl]-2,2,4-trimethyl-1,3-dioxolane Structure](https://image.chemsrc.com/caspic/180/80320-89-4.png)
(4R)-4-[2-(benzenesulfonyl)ethyl]-2,2,4-trimethyl-1,3-dioxolane structure
|
Common Name | (4R)-4-[2-(benzenesulfonyl)ethyl]-2,2,4-trimethyl-1,3-dioxolane | ||
|---|---|---|---|---|
| CAS Number | 80320-89-4 | Molecular Weight | 284.37100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4R)-4-[2-(benzenesulfonyl)ethyl]-2,2,4-trimethyl-1,3-dioxolane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H20O4S |
|---|---|
| Molecular Weight | 284.37100 |
| Exact Mass | 284.10800 |
| PSA | 60.98000 |
| LogP | 3.47280 |
| InChIKey | WZRPTVPVMOGKTF-CQSZACIVSA-N |
| SMILES | CC1(CCS(=O)(=O)c2ccccc2)COC(C)(C)O1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
(4R)-4-[2-(benz... CAS#:80320-89-4 |
| Literature: Yamada; Nakayama; Takayama; et al. Tetrahedron Letters, 1984 , vol. 25, # 30 p. 3239 - 3242 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,3-Dioxolane,2,2,4-trimethyl-4-[2-(phenylsulfonyl)ethyl]-,(R) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of (4R)-4-[2-(benzenesulfonyl)ethyl]-2,2,4-trimethyl-1,3-dioxolane? |
| A: SMILES notation of (4R)-4-[2-(benzenesulfonyl)ethyl]-2,2,4-trimethyl-1,3-dioxolane is CC1(CCS(=O)(=O)c2ccccc2)COC(C)(C)O1. |
| Q: What is the Chinese name of 80320-89-4? |
| A: Chinese name of 80320-89-4 is 80320-89-4. |
| Q: What English synonyms does (4R)-4-[2-(benzenesulfonyl)ethyl]-2,2,4-trimethyl-1,3-dioxolane have? |
| A: English synonyms of (4R)-4-[2-(benzenesulfonyl)ethyl]-2,2,4-trimethyl-1,3-dioxolane: 1,3-Dioxolane,2,2,4-trimethyl-4-[2-(phenylsulfonyl)ethyl]-,(R). |
| Q: What is the English name of (4R)-4-[2-(benzenesulfonyl)ethyl]-2,2,4-trimethyl-1,3-dioxolane? |
| A: The English name of (4R)-4-[2-(benzenesulfonyl)ethyl]-2,2,4-trimethyl-1,3-dioxolane is (4R)-4-[2-(benzenesulfonyl)ethyl]-2,2,4-trimethyl-1,3-dioxolane. |
| Q: What are the upstream materials of (4R)-4-[2-(benzenesulfonyl)ethyl]-2,2,4-trimethyl-1,3-dioxolane? |
| A: Related upstream materials(CAS) of (4R)-4-[2-(benzenesulfonyl)ethyl]-2,2,4-trimethyl-1,3-dioxolane: 6236-10-8. |
| Q: What is the molecular formula of (4R)-4-[2-(benzenesulfonyl)ethyl]-2,2,4-trimethyl-1,3-dioxolane? |
| A: Molecular formula of (4R)-4-[2-(benzenesulfonyl)ethyl]-2,2,4-trimethyl-1,3-dioxolane is C14H20O4S. |
| Q: What is the InChIKey of (4R)-4-[2-(benzenesulfonyl)ethyl]-2,2,4-trimethyl-1,3-dioxolane? |
| A: InChIKey of (4R)-4-[2-(benzenesulfonyl)ethyl]-2,2,4-trimethyl-1,3-dioxolane is WZRPTVPVMOGKTF-CQSZACIVSA-N. |
| Q: What is the LogP of (4R)-4-[2-(benzenesulfonyl)ethyl]-2,2,4-trimethyl-1,3-dioxolane? |
| A: LogP of (4R)-4-[2-(benzenesulfonyl)ethyl]-2,2,4-trimethyl-1,3-dioxolane is 3.47280. |
| Q: What is the molecular weight of (4R)-4-[2-(benzenesulfonyl)ethyl]-2,2,4-trimethyl-1,3-dioxolane? |
| A: Molecular weight of (4R)-4-[2-(benzenesulfonyl)ethyl]-2,2,4-trimethyl-1,3-dioxolane is 284.37100. |
| Q: What is the polar surface area (PSA) of (4R)-4-[2-(benzenesulfonyl)ethyl]-2,2,4-trimethyl-1,3-dioxolane? |
| A: Polar surface area (PSA) of (4R)-4-[2-(benzenesulfonyl)ethyl]-2,2,4-trimethyl-1,3-dioxolane is 60.98000. |