(2,4,5-trichlorophenyl) N-(2-chloroethyl)-N-nitroso-carbamate structure
|
Common Name | (2,4,5-trichlorophenyl) N-(2-chloroethyl)-N-nitroso-carbamate | ||
|---|---|---|---|---|
| CAS Number | 80354-51-4 | Molecular Weight | 331.96800 | |
| Density | 1.63g/cm3 | Boiling Point | 399.6ºC at 760 mmHg | |
| Molecular Formula | C9H6Cl4N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.5ºC | |
| Name | (2,4,5-trichlorophenyl) N-(2-chloroethyl)-N-nitrosocarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.63g/cm3 |
|---|---|
| Boiling Point | 399.6ºC at 760 mmHg |
| Molecular Formula | C9H6Cl4N2O3 |
| Molecular Weight | 331.96800 |
| Flash Point | 195.5ºC |
| Exact Mass | 329.91300 |
| PSA | 58.97000 |
| LogP | 4.36780 |
| Index of Refraction | 1.606 |
| InChIKey | WJSDAFAYDXCQLE-UHFFFAOYSA-N |
| SMILES | O=NN(CCCl)C(=O)Oc1cc(Cl)c(Cl)cc1Cl |
|
~94%
(2,4,5-trichlor... CAS#:80354-51-4 |
| Literature: Martinez, Jean; Oiry, Joel; Imbach, Jean Louis; Winternitz, Francois Journal of Medicinal Chemistry, 1982 , vol. 25, # 2 p. 178 - 182 |
|
~%
(2,4,5-trichlor... CAS#:80354-51-4 |
| Literature: Elkihel; Gelin; Letourneux Arzneimittel-Forschung/Drug Research, 1995 , vol. 45, # 2 p. 190 - 194 |
| N-(chloro-2 ethyl)N-nitrosocarbamate de trichloro-2,4,5 phenyle |
| 2,4,5-trichlorophenyl N-(2-trichloroethyl)-N-nitrosocarbamate |
| 2,4,5-trichlorophenyl N-(2-chloroethyl)-N-nitrosocarbamate |
| 2,43,5-trichlorophenyl N-(2-chloroethyl)-N-nitrosocarbamate |
| (2-chloroethyl)nitrosocarbamic acid 2,4,5-trichlorophenyl ester |