CID 15573771
Modify Date: 2026-08-23 18:19:22
CID 15573771 structure
|
Common Name | CID 15573771 | ||
|---|---|---|---|---|
| CAS Number | 80355-06-2 | Molecular Weight | 194.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | CID 15573771 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H14N2O2 |
|---|---|
| Molecular Weight | 194.23 |
| InChIKey | IFIAXYXFJVHQES-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)C2(CC3CCC(C3)C2)N1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of CID 15573771? |
| A: The English name of CID 15573771 is CID 15573771. |
| Q: What is the molecular formula of CID 15573771? |
| A: Molecular formula of CID 15573771 is C10H14N2O2. |
| Q: What is the SMILES notation of CID 15573771? |
| A: SMILES notation of CID 15573771 is O=C1NC(=O)C2(CC3CCC(C3)C2)N1. |
| Q: What is the CAS number of CID 15573771? |
| A: CAS number of CID 15573771 is 80355-06-2. |
| Q: What is the Chinese name of 80355-06-2? |
| A: Chinese name of 80355-06-2 is 80355-06-2. |
| Q: What is the InChIKey of CID 15573771? |
| A: InChIKey of CID 15573771 is IFIAXYXFJVHQES-UHFFFAOYSA-N. |
| Q: What is the molecular weight of CID 15573771? |
| A: Molecular weight of CID 15573771 is 194.23. |