Tinnevellin glucoside structure
|
Common Name | Tinnevellin glucoside | ||
|---|---|---|---|---|
| CAS Number | 80358-06-1 | Molecular Weight | 408.399 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 676.9±55.0 °C at 760 mmHg | |
| Molecular Formula | C20H24O9 | Melting Point | 175 °C | |
| MSDS | N/A | Flash Point | 239.8±25.0 °C | |
Use of Tinnevellin glucosideTinnevellin glucoside, a naphthalene glycoside, isolated from Cassia senna leaves and pods[1]. |
| Name | 1-[1-hydroxy-8-methoxy-3-methyl-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynaphthalen-2-yl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Description | Tinnevellin glucoside, a naphthalene glycoside, isolated from Cassia senna leaves and pods[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 676.9±55.0 °C at 760 mmHg |
| Melting Point | 175 °C |
| Molecular Formula | C20H24O9 |
| Molecular Weight | 408.399 |
| Flash Point | 239.8±25.0 °C |
| Exact Mass | 408.142029 |
| PSA | 145.91000 |
| LogP | 0.91 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.656 |
| InChIKey | FEZDDTIDMGTSLT-CZNQJBLBSA-N |
| SMILES | COc1cc(OC2OC(CO)C(O)C(O)C2O)cc2cc(C)c(C(C)=O)c(O)c12 |
| Ethanone, 1-(6-(β-D-glucopyranosyloxy)-1-hydroxy-8-methoxy-3-methyl-2-naphthalenyl)- |
| 6-Acetyl-5-hydroxy-4-methoxy-7-methyl-2-naphthyl β-D-glucopyranoside |
| Ethanone, 1-[6-(β-D-glucopyranosyloxy)-1-hydroxy-8-methoxy-3-methyl-2-naphthalenyl]- |