2-(2-amino-3-bromo-5-methyl-phenyl)-1,1,1,3,3,3-hexafluoro-propan-2-ol structure
|
Common Name | 2-(2-amino-3-bromo-5-methyl-phenyl)-1,1,1,3,3,3-hexafluoro-propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 80360-40-3 | Molecular Weight | 352.07100 | |
| Density | 1.72g/cm3 | Boiling Point | 323.6ºC at 760 mmHg | |
| Molecular Formula | C10H8BrF6NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149.5ºC | |
| Name | 2-(2-amino-3-bromo-5-methylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|
| Density | 1.72g/cm3 |
|---|---|
| Boiling Point | 323.6ºC at 760 mmHg |
| Molecular Formula | C10H8BrF6NO |
| Molecular Weight | 352.07100 |
| Flash Point | 149.5ºC |
| Exact Mass | 350.96900 |
| PSA | 46.25000 |
| LogP | 4.23310 |
| Index of Refraction | 1.49 |
| InChIKey | XHSHLWNKEGGUSW-UHFFFAOYSA-N |
| SMILES | Cc1cc(Br)c(N)c(C(O)(C(F)(F)F)C(F)(F)F)c1 |
|
~%
2-(2-amino-3-br... CAS#:80360-40-3 |
| Literature: Nguyen, Tuyen T.; Martin, J. C. Journal of the American Chemical Society, 1980 , vol. 102, # 24 p. 7382 - 7383 |