1-(2,4-dimethoxyphenyl)-3-phenyl-propane-1,3-dione structure
|
Common Name | 1-(2,4-dimethoxyphenyl)-3-phenyl-propane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 80370-26-9 | Molecular Weight | 284.30700 | |
| Density | 1.16g/cm3 | Boiling Point | 463.7ºC at 760 mmHg | |
| Molecular Formula | C17H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.4ºC | |
| Name | 1-(2,4-Dimethoxy-phenyl)-3-(2-hydroxyethyl)thiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 463.7ºC at 760 mmHg |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.30700 |
| Flash Point | 206.4ºC |
| Exact Mass | 284.10500 |
| PSA | 52.60000 |
| LogP | 3.15950 |
| Index of Refraction | 1.56 |
| InChIKey | AEEAKBXAXKZQPA-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)CC(=O)c2ccccc2)c(OC)c1 |
|
~60%
1-(2,4-dimethox... CAS#:80370-26-9 |
| Literature: Choshi; horimoto; Wang; Nagase; Ichikawa; Sugino; Hibino Chemical and Pharmaceutical Bulletin, 1992 , vol. 40, # 4 p. 1047 - 1049 |
|
~%
1-(2,4-dimethox... CAS#:80370-26-9 |
| Literature: Perkin; Schiess Journal of the Chemical Society, 1904 , vol. 85, p. 162 |
|
~%
1-(2,4-dimethox... CAS#:80370-26-9 |
| Literature: Perkin; Schiess Journal of the Chemical Society, 1904 , vol. 85, p. 162 |
| Thiourea,N-(2,4-dimethoxyphenyl)-N'-(2-hydroxyethyl) |
| 1-(2,4-dimethoxy-phenyl)-3-phenyl-propane-1,3-dione |
| 1-(2,4-dimethoxyphenyl)-3-phenyl-1,3-propanedione |
| 1-(2,4-Dimethoxy-phenyl)-3-phenyl-propan-1,3-dion |