1-nitro-3-pent-1-ynylbenzene structure
|
Common Name | 1-nitro-3-pent-1-ynylbenzene | ||
|---|---|---|---|---|
| CAS Number | 803730-26-9 | Molecular Weight | 189.21100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-nitro-3-pent-1-ynylbenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H11NO2 |
|---|---|
| Molecular Weight | 189.21100 |
| Exact Mass | 189.07900 |
| PSA | 45.82000 |
| LogP | 3.26960 |
| InChIKey | KFACMMXZVFKIDC-UHFFFAOYSA-N |
| SMILES | CCCC#Cc1cccc([N+](=O)[O-])c1 |
|
~89%
1-nitro-3-pent-... CAS#:803730-26-9 |
| Literature: Ortar, Giorgio; Cascio, Maria Grazia; De Petrocellis, Luciano; Morera, Enrico; Rossi, Francesca; Schiano-Moriello, Aniello; Nalli, Marianna; De Novellis, Vito; Woodward, David F.; Maione, Sabatino; Di Marzo, Vincenzo Journal of Medicinal Chemistry, 2007 , vol. 50, # 26 p. 6554 - 6569 |
|
~59%
1-nitro-3-pent-... CAS#:803730-26-9 |
| Literature: Fortin, Sebastien; Moreau, Emmanuel; Patenaude, Alexandre; Desjardins, Michel; Lacroix, Jacques; Rousseau, Jean L.C.; C-Gaudreault, Rene Bioorganic and Medicinal Chemistry, 2007 , vol. 15, # 3 p. 1430 - 1438 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Benzene,1-nitro-3-(1-pentynyl) |
| 1-nitro-3-pentynylbenzene |
| 1-nitro-3-(1-pentynyl)benzene |