14-Azadispiro[5.1.5.2]pentadec-9-ene-7,15-dione, 14-hydroxy-, 7-oxime structure
|
Common Name | 14-Azadispiro[5.1.5.2]pentadec-9-ene-7,15-dione, 14-hydroxy-, 7-oxime | ||
|---|---|---|---|---|
| CAS Number | 80382-65-6 | Molecular Weight | 264.32000 | |
| Density | 1.38g/cm3 | Boiling Point | 485.6ºC at 760 mmHg | |
| Molecular Formula | C14H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.5ºC | |
| Name | (7E)-14-hydroxy-7-hydroxyimino-14-azadispiro[5.1.58.26]pentadec-12-en-15-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 485.6ºC at 760 mmHg |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32000 |
| Flash Point | 247.5ºC |
| Exact Mass | 264.14700 |
| PSA | 73.13000 |
| LogP | 2.41530 |
| Index of Refraction | 1.656 |
| InChIKey | FTANTFDDWBMRRV-RVDMUPIBSA-N |
| SMILES | O=C1N(O)C2(C=CCCC2)C(=NO)C12CCCCC2 |
|
~%
14-Azadispiro[5... CAS#:80382-65-6 |
| Literature: Nightingale et al. Journal of Organic Chemistry, 1958 , vol. 23, p. 236,241 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HMS1617K14 |
| CCG-2436 |
| 14-Hydroxy-14-aza-dispiro<5.1.5.2>pentadec-9-en-7,15-dion-7-oxim |