1,5-Bis(3-aminophenyl)-1,4-pentadien-3-one
Modify Date: 2026-08-21 07:13:56
1,5-Bis(3-aminophenyl)-1,4-pentadien-3-one structure
|
Common Name | 1,5-Bis(3-aminophenyl)-1,4-pentadien-3-one | ||
|---|---|---|---|---|
| CAS Number | 80396-67-4 | Molecular Weight | 264.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,5-Bis(3-aminophenyl)-1,4-pentadien-3-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H16N2O |
|---|---|
| Molecular Weight | 264.32 |
| InChIKey | DDXHZFTWGPFISH-UHFFFAOYSA-N |
| SMILES | Nc1cccc(C=CC(=O)C=Cc2cccc(N)c2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1,5-Bis(3-aminophenyl)-1,4-pentadien-3-one? |
| A: InChIKey of 1,5-Bis(3-aminophenyl)-1,4-pentadien-3-one is DDXHZFTWGPFISH-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1,5-Bis(3-aminophenyl)-1,4-pentadien-3-one? |
| A: Molecular formula of 1,5-Bis(3-aminophenyl)-1,4-pentadien-3-one is C17H16N2O. |
| Q: What is the CAS number of 1,5-Bis(3-aminophenyl)-1,4-pentadien-3-one? |
| A: CAS number of 1,5-Bis(3-aminophenyl)-1,4-pentadien-3-one is 80396-67-4. |
| Q: What is the molecular weight of 1,5-Bis(3-aminophenyl)-1,4-pentadien-3-one? |
| A: Molecular weight of 1,5-Bis(3-aminophenyl)-1,4-pentadien-3-one is 264.32. |
| Q: What is the Chinese name of 80396-67-4? |
| A: Chinese name of 80396-67-4 is 80396-67-4. |
| Q: What is the English name of 1,5-Bis(3-aminophenyl)-1,4-pentadien-3-one? |
| A: The English name of 1,5-Bis(3-aminophenyl)-1,4-pentadien-3-one is 1,5-Bis(3-aminophenyl)-1,4-pentadien-3-one. |
| Q: What is the SMILES notation of 1,5-Bis(3-aminophenyl)-1,4-pentadien-3-one? |
| A: SMILES notation of 1,5-Bis(3-aminophenyl)-1,4-pentadien-3-one is Nc1cccc(C=CC(=O)C=Cc2cccc(N)c2)c1. |