Payzone
Payzone structure
|
Common Name | Payzone | ||
|---|---|---|---|---|
| CAS Number | 804-36-4 | Molecular Weight | 360.282 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 550.3±60.0 °C at 760 mmHg | |
| Molecular Formula | C14H12N6O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 286.6±32.9 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Difurazone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 550.3±60.0 °C at 760 mmHg |
| Molecular Formula | C14H12N6O6 |
| Molecular Weight | 360.282 |
| Flash Point | 286.6±32.9 °C |
| Exact Mass | 360.081818 |
| PSA | 192.18000 |
| LogP | 2.58 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.680 |
| InChIKey | XQCFHQBGMWUEMY-UHFFFAOYSA-N |
| SMILES | NC(N)=NN=C(C=Cc1ccc([N+](=O)[O-])o1)C=Cc1ccc([N+](=O)[O-])o1 |
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2309901000 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2309901000 |
|---|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,5-bis(5-nitro-2-furyl)-3-pentadienoneamidinonhydrazone |
| NITROVIN |
| EINECS 212-358-7 |
| 2-[(1E,4E)-1,5-Bis(5-nitro-2-furyl)-1,4-pentadien-3-ylidene]hydrazinecarboximidamide |
| NitrovinHCl |
| Nitrovin (tn) |
| 2-[(1E,4E)-1,5-Bis(5-nitro-2-furyl)penta-1,4-dien-3-ylidene]hydrazinecarboximidamide |
| Payzone |
| Panazone |
| 2-[(1E,4E)-1,5-bis(5-nitrofuran-2-yl)penta-1,4-dien-3-ylidene]hydrazinecarboximidamide |
| sym-Bis(5-nitro-2-furfurylidene)acetone Guanylhydrazone |
| sym-bis(5-nitro-2-furfurylidene)acetoneguanylhydrazone |
| 1,5-Bis(5-nitro-2-furyl)-3-pentadienone Amidinohydrazone |
| bis(5-nitrofurfurylidene)acetoneguanylhydrazone |
| [[3-(5-Nitro-2-furyl)-1-[2-(5-nitro-2-furyl)vinyl]allylidene]amino]guanidine |
| 2-[3-(5-Nitro-2-furanyl)-1-[2-(5-nitro-2-furanyl)ethenyl]-2-propenylidene]hydrazinecarboximidamide |
| 1,5-bis(5-nitro-2-furyl)-3-pentadienoneguanylhydrazone |
| MFCD00242892 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Difurazone? |
| A: Molecular weight of Difurazone is 360.282. |
| Q: What is the LogP of Difurazone? |
| A: LogP of Difurazone is 2.58. |
| Q: What is the polar surface area (PSA) of Difurazone? |
| A: Polar surface area (PSA) of Difurazone is 192.18000. |
| Q: What is the CAS number of Difurazone? |
| A: CAS number of Difurazone is 804-36-4. |
| Q: What is the boiling point of Difurazone? |
| A: Boiling point of Difurazone is 550.3±60.0 °C at 760 mmHg. |
| Q: What is the InChIKey of Difurazone? |
| A: InChIKey of Difurazone is XQCFHQBGMWUEMY-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Difurazone? |
| A: Molecular formula of Difurazone is C14H12N6O6. |
| Q: What is the SMILES notation of Difurazone? |
| A: SMILES notation of Difurazone is NC(N)=NN=C(C=Cc1ccc([N+](=O)[O-])o1)C=Cc1ccc([N+](=O)[O-])o1. |
| Q: What is the English name of Difurazone? |
| A: The English name of Difurazone is Difurazone. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |