Notoginsenoside R2 structure
|
Common Name | Notoginsenoside R2 | ||
|---|---|---|---|---|
| CAS Number | 80418-25-3 | Molecular Weight | 770.987 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 878.7±65.0 °C at 760 mmHg | |
| Molecular Formula | C41H70O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 485.2±34.3 °C | |
Use of Notoginsenoside R2Notoginsenoside R2 is a newly isolated notoginsenoside from Panax notoginseng, showed neuroprotective effects against 6-OHDA-induced oxidative stress and apoptosis. |
| Name | (3β,6α,12β)-3,12,20-Trihydroxydammar-24-en-6-yl 2-O-β-D-xylopyran osyl-β-D-glucopyranoside |
|---|---|
| Synonym | More Synonyms |
| Description | Notoginsenoside R2 is a newly isolated notoginsenoside from Panax notoginseng, showed neuroprotective effects against 6-OHDA-induced oxidative stress and apoptosis. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 878.7±65.0 °C at 760 mmHg |
| Molecular Formula | C41H70O13 |
| Molecular Weight | 770.987 |
| Flash Point | 485.2±34.3 °C |
| Exact Mass | 770.481628 |
| PSA | 218.99000 |
| LogP | 6.45 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | FNIRVWPHRMMRQI-PGOMJGFXSA-N |
| SMILES | CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O)C(O)C3OC3OCC(O)C(O)C3O)CC12C |
| Storage condition | 2-8°C |
|
Name: Inhibition of cell proliferation of rat C6 cells assessed as cell viability at 100 uM...
Source: ChEMBL
Target: C6
External Id: CHEMBL3385797
|
|
Name: Inhibition of cell proliferation of human U251 cells assessed as cell viability at 10...
Source: ChEMBL
Target: U-251
External Id: CHEMBL3385796
|
| NOTOGINSENOSIDE R1(SH) |
| notoginsenoside Rh1 |
| NOTOGINSENOSIDE |
| Sanchinoside R1 |
| notogisenoside R1 |
| 20(S)-NotoginsenosideR2 |
| ginsenoside-Rg2 |
| notoginsenoside-Rg2 |
| notoginsenoside-R1 |
| (3β,6α,12β)-3,12,20-Trihydroxydammar-24-en-6-yl 2-O-β-D-xylopyranosyl-β-D-glucopyranoside |
| notoginsenoside-R2 |
| ginsenoside R2 |
| 20(S)-Notoginsenoside R2 |
| Notoginsenoside R2 |