2,4-ditert-butyl-6-chloroaniline structure
|
Common Name | 2,4-ditert-butyl-6-chloroaniline | ||
|---|---|---|---|---|
| CAS Number | 80438-53-5 | Molecular Weight | 239.78400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H22ClN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4-ditert-butyl-6-chloroaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H22ClN |
|---|---|
| Molecular Weight | 239.78400 |
| Exact Mass | 239.14400 |
| PSA | 26.02000 |
| LogP | 5.09840 |
| InChIKey | VFXCLHCOKQTJHQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(Cl)c(N)c(C(C)(C)C)c1 |
|
~%
2,4-ditert-buty... CAS#:80438-53-5 |
| Literature: Koning, Adrianus Jan de Recueil: Journal of the Royal Netherlands Chemical Society, 1981 , vol. 100, # 11 p. 421 - 425 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-chloro-4,6-di-t-butylaniline |
| 2-chloro-4,6-di-tert-butylaniline |
| Benzenamine,2-chloro-4,6-bis(1,1-dimethylethyl) |