7-Chloro-3,4-dihydro-1,4-dimethyl-1H-1-benzazepine-2,5-dione
Modify Date: 2026-07-20 13:19:38
7-Chloro-3,4-dihydro-1,4-dimethyl-1H-1-benzazepine-2,5-dione structure
|
Common Name | 7-Chloro-3,4-dihydro-1,4-dimethyl-1H-1-benzazepine-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 80452-56-8 | Molecular Weight | 237.68 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-Chloro-3,4-dihydro-1,4-dimethyl-1H-1-benzazepine-2,5-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H12ClNO2 |
|---|---|
| Molecular Weight | 237.68 |
| InChIKey | FOZIDTOLOFAKLA-UHFFFAOYSA-N |
| SMILES | CC1CC(=O)N(C)c2ccc(Cl)cc2C1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 7-Chloro-3,4-dihydro-1,4-dimethyl-1H-1-benzazepine-2,5-dione? |
| A: The English name of 7-Chloro-3,4-dihydro-1,4-dimethyl-1H-1-benzazepine-2,5-dione is 7-Chloro-3,4-dihydro-1,4-dimethyl-1H-1-benzazepine-2,5-dione. |
| Q: What is the molecular weight of 7-Chloro-3,4-dihydro-1,4-dimethyl-1H-1-benzazepine-2,5-dione? |
| A: Molecular weight of 7-Chloro-3,4-dihydro-1,4-dimethyl-1H-1-benzazepine-2,5-dione is 237.68. |
| Q: What is the SMILES notation of 7-Chloro-3,4-dihydro-1,4-dimethyl-1H-1-benzazepine-2,5-dione? |
| A: SMILES notation of 7-Chloro-3,4-dihydro-1,4-dimethyl-1H-1-benzazepine-2,5-dione is CC1CC(=O)N(C)c2ccc(Cl)cc2C1=O. |
| Q: What is the molecular formula of 7-Chloro-3,4-dihydro-1,4-dimethyl-1H-1-benzazepine-2,5-dione? |
| A: Molecular formula of 7-Chloro-3,4-dihydro-1,4-dimethyl-1H-1-benzazepine-2,5-dione is C12H12ClNO2. |
| Q: What is the CAS number of 7-Chloro-3,4-dihydro-1,4-dimethyl-1H-1-benzazepine-2,5-dione? |
| A: CAS number of 7-Chloro-3,4-dihydro-1,4-dimethyl-1H-1-benzazepine-2,5-dione is 80452-56-8. |
| Q: What is the InChIKey of 7-Chloro-3,4-dihydro-1,4-dimethyl-1H-1-benzazepine-2,5-dione? |
| A: InChIKey of 7-Chloro-3,4-dihydro-1,4-dimethyl-1H-1-benzazepine-2,5-dione is FOZIDTOLOFAKLA-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 80452-56-8? |
| A: Chinese name of 80452-56-8 is 80452-56-8. |