hexahydro-1,3,5-tris(2,2,6,6-tetramethyl-4-piperidyl)-1,3,5-triazine structure
|
Common Name | hexahydro-1,3,5-tris(2,2,6,6-tetramethyl-4-piperidyl)-1,3,5-triazine | ||
|---|---|---|---|---|
| CAS Number | 80458-17-9 | Molecular Weight | 504.83800 | |
| Density | 0.937g/cm3 | Boiling Point | 537.8ºC at 760 mmHg | |
| Molecular Formula | C30H60N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.8ºC | |
| Name | 1,3,5-tris(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazinane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.937g/cm3 |
|---|---|
| Boiling Point | 537.8ºC at 760 mmHg |
| Molecular Formula | C30H60N6 |
| Molecular Weight | 504.83800 |
| Flash Point | 247.8ºC |
| Exact Mass | 504.48800 |
| PSA | 45.81000 |
| LogP | 5.50620 |
| Index of Refraction | 1.483 |
| InChIKey | XHQJBVUCGLYKNR-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(N2CN(C3CC(C)(C)NC(C)(C)C3)CN(C3CC(C)(C)NC(C)(C)C3)C2)CC(C)(C)N1 |
|
~86%
hexahydro-1,3,5... CAS#:80458-17-9 |
| Literature: Golubev, V. A.; Rashba, Yu. E. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1982 , vol. 31, # 12 p. 2445 - 2450 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1982 , # 12 p. 2766 - 2772 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,3,5-tris(2,2,6,6-tetramethylpiperidin-4-yl)-[1,3,5]-triazinane |
| HEXAHYDRO-1,3,5-TRIS(2,2,6,6-TETRAMETHYL-PIPERIDIN-4-YL)-1,3,5-TRIAZINE |
| 1,3,5-tris(2,2,6,6-tetramethylpiperidin-4-yl)[1,3,5]trazinane |
| CCG-8722 |
| 1,3,5-tris(2,2,6,6-tetramethylpiperidin-4-yl)hexahydrotriazine |