N-[3-(dimethylamino)propyl]-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanesulphonamide N-oxide
Modify Date: 2026-08-06 13:15:55
![N-[3-(dimethylamino)propyl]-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanesulphonamide N-oxide Structure](https://image.chemsrc.com/caspic/200/80475-32-7.png)
N-[3-(dimethylamino)propyl]-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanesulphonamide N-oxide structure
|
Common Name | N-[3-(dimethylamino)propyl]-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanesulphonamide N-oxide | ||
|---|---|---|---|---|
| CAS Number | 80475-32-7 | Molecular Weight | 528.33 | |
| Density | 1.51g/cm3 | Boiling Point | 373.4ºC at 760 mmHg | |
| Molecular Formula | C6F13CH2CH2SO2NHCH2CH2CH2N(=O)(CH3)2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.6ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(dimethylamino)-N-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfonyl)propan-1-amine oxide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.51g/cm3 |
|---|---|
| Boiling Point | 373.4ºC at 760 mmHg |
| Molecular Formula | C6F13CH2CH2SO2NHCH2CH2CH2N(=O)(CH3)2 |
| Molecular Weight | 528.33 |
| Flash Point | 179.6ºC |
| Exact Mass | 528.0752297 |
| PSA | 75.19000 |
| LogP | 5.77970 |
| Index of Refraction | 1.386 |
| InChIKey | KBDMGVIUNQWTND-UHFFFAOYSA-N |
| SMILES | C[N+](C)(CCCNS(=O)(=O)CCC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)[O-] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 3-(dimethylamino)-N-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfonyl)propan-1-amine oxide? |
| A: SMILES notation of 3-(dimethylamino)-N-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfonyl)propan-1-amine oxide is C[N+](C)(CCCNS(=O)(=O)CCC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)[O-]. |
| Q: What is the molecular formula of 3-(dimethylamino)-N-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfonyl)propan-1-amine oxide? |
| A: Molecular formula of 3-(dimethylamino)-N-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfonyl)propan-1-amine oxide is C6F13CH2CH2SO2NHCH2CH2CH2N(=O)(CH3)2. |
| Q: What is the polar surface area (PSA) of 3-(dimethylamino)-N-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfonyl)propan-1-amine oxide? |
| A: Polar surface area (PSA) of 3-(dimethylamino)-N-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfonyl)propan-1-amine oxide is 75.19000. |
| Q: What is the Chinese name of 80475-32-7? |
| A: Chinese name of 80475-32-7 is 80475-32-7. |
| Q: What is the molecular weight of 3-(dimethylamino)-N-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfonyl)propan-1-amine oxide? |
| A: Molecular weight of 3-(dimethylamino)-N-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfonyl)propan-1-amine oxide is 528.33. |
| Q: What is the boiling point of 3-(dimethylamino)-N-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfonyl)propan-1-amine oxide? |
| A: Boiling point of 3-(dimethylamino)-N-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfonyl)propan-1-amine oxide is 373.4ºC at 760 mmHg. |
| Q: What is the LogP of 3-(dimethylamino)-N-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfonyl)propan-1-amine oxide? |
| A: LogP of 3-(dimethylamino)-N-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfonyl)propan-1-amine oxide is 5.77970. |
| Q: What is the InChIKey of 3-(dimethylamino)-N-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfonyl)propan-1-amine oxide? |
| A: InChIKey of 3-(dimethylamino)-N-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfonyl)propan-1-amine oxide is KBDMGVIUNQWTND-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3-(dimethylamino)-N-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfonyl)propan-1-amine oxide? |
| A: CAS number of 3-(dimethylamino)-N-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfonyl)propan-1-amine oxide is 80475-32-7. |
| Q: What is the English name of 3-(dimethylamino)-N-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfonyl)propan-1-amine oxide? |
| A: The English name of 3-(dimethylamino)-N-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfonyl)propan-1-amine oxide is 3-(dimethylamino)-N-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfonyl)propan-1-amine oxide. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |