9-chloro-10-methoxyanthracene-1,4-dione structure
|
Common Name | 9-chloro-10-methoxyanthracene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 80490-15-9 | Molecular Weight | 272.68300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H9ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 9-chloro-10-methoxyanthracene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H9ClO3 |
|---|---|
| Molecular Weight | 272.68300 |
| Exact Mass | 272.02400 |
| PSA | 43.37000 |
| LogP | 3.43700 |
| InChIKey | GZIPPUHNGMAMND-UHFFFAOYSA-N |
| SMILES | COc1c2c(c(Cl)c3ccccc13)C(=O)C=CC2=O |
|
~99%
9-chloro-10-met... CAS#:80490-15-9 |
| Literature: Carretero, Juan Carlos; Cuevas, Juan Carlos; Echavarren, Antonio; Prados, Pilar; Farina, Francisco Journal of Chemical Research, Miniprint, 1984 , # 1 p. 147 - 194 |
|
~%
9-chloro-10-met... CAS#:80490-15-9 |
| Literature: Carretero, Juan Carlos; Cuevas, Juan Carlos; Echavarren, Antonio; Prados, Pilar; Farina, Francisco Journal of Chemical Research, Miniprint, 1984 , # 1 p. 147 - 194 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 9-chloro-10-methoxy-1,4-anthraquinone |
| 9-methoxy-10-chloro-1,4-anthraquinone |
| 1,4-Anthracenedione,9-chloro-10-methoxy |