2H-1-Benzopyran-2-one,8-[[bis(2-hydroxyethyl)amino]methyl]-7-hydroxy-4-phenyl- structure
|
Common Name | 2H-1-Benzopyran-2-one,8-[[bis(2-hydroxyethyl)amino]methyl]-7-hydroxy-4-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 80494-06-0 | Molecular Weight | 355.38400 | |
| Density | 1.354g/cm3 | Boiling Point | 623.7ºC at 760mmHg | |
| Molecular Formula | C20H21NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 331ºC | |
| Name | 8-[[bis(2-hydroxyethyl)amino]methyl]-7-hydroxy-4-phenylchromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.354g/cm3 |
|---|---|
| Boiling Point | 623.7ºC at 760mmHg |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.38400 |
| Flash Point | 331ºC |
| Exact Mass | 355.14200 |
| PSA | 94.14000 |
| LogP | 1.95220 |
| Index of Refraction | 1.655 |
| InChIKey | CVTFGNYCOFIWOG-UHFFFAOYSA-N |
| SMILES | O=c1cc(-c2ccccc2)c2ccc(O)c(CN(CCO)CCO)c2o1 |
|
~%
2H-1-Benzopyran... CAS#:80494-06-0 |
| Literature: Rao; Raju Journal of the Indian Chemical Society, 1981 , vol. 58, # 10 p. 1021 - 1023 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 8-{[bis-(2-hydroxy-ethyl)-amino]-methyl}-7-hydroxy-4-phenyl-chromen-2-one |
| 4-Phenyl-8-<N.N-bis-(2-hydroxy-aethyl)-aminomethyl>-7-hydroxy-cumarin |
| 8-diethanolaminomethyl-7-hydroxy-4-phenyl coumarin |