Euchrestaflavanone A structure
|
Common Name | Euchrestaflavanone A | ||
|---|---|---|---|---|
| CAS Number | 80510-05-0 | Molecular Weight | 408.48700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H28O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Euchrestaflavanone AEuchrestaflavanone A is a flavonoid found in the root bark of Cudrania tricuspidate. Euchrestaflavanone A inhibits platelet aggregation and has some antiplatelet and antithrombotic properties, making it a potential compound for thromboprophylaxis[1]. |
| Name | Euchrestaflavanone A |
|---|---|
| Synonym | More Synonyms |
| Description | Euchrestaflavanone A is a flavonoid found in the root bark of Cudrania tricuspidate. Euchrestaflavanone A inhibits platelet aggregation and has some antiplatelet and antithrombotic properties, making it a potential compound for thromboprophylaxis[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C25H28O5 |
|---|---|
| Molecular Weight | 408.48700 |
| Exact Mass | 408.19400 |
| PSA | 86.99000 |
| LogP | 5.52730 |
| InChIKey | BMIMEYWWZBBDCM-QHCPKHFHSA-N |
| SMILES | CC(C)=CCc1cc(C2CC(=O)c3c(O)cc(O)c(CC=C(C)C)c3O2)ccc1O |
| euchrestaflavanone A |
| lespedezaflavanone B |
| (S)-5,7-Dihydroxy-2-[4-hydroxy-3-(3-methyl-but-2-enyl)-phenyl]-8-(3-methyl-but-2-enyl)-chroman-4-one |