1-(chloromethyl)-4-(1-chloro-2,2,2-trifluoroethyl)benzene structure
|
Common Name | 1-(chloromethyl)-4-(1-chloro-2,2,2-trifluoroethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 805323-40-4 | Molecular Weight | 243.05300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7Cl2F3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(chloromethyl)-4-(1-chloro-2,2,2-trifluoroethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H7Cl2F3 |
|---|---|
| Molecular Weight | 243.05300 |
| Exact Mass | 241.98800 |
| LogP | 4.26760 |
| InChIKey | FNNJDRRCAFUQRQ-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(Cl)c1ccc(CCl)cc1 |
|
~59%
1-(chloromethyl... CAS#:805323-40-4 |
| Literature: Roche, Alex J.; Loyle, Anne D.; Pinto, Jean-Pierre Journal of Fluorine Chemistry, 2004 , vol. 125, # 10 p. 1473 - 1480 |
|
~%
1-(chloromethyl... CAS#:805323-40-4 |
| Literature: Roche, Alex J.; Loyle, Anne D.; Pinto, Jean-Pierre Journal of Fluorine Chemistry, 2004 , vol. 125, # 10 p. 1473 - 1480 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-(1-chloro-2,2,2-trifluoroethyl)-4-(chloromethyl)benzene |
| Benzene,1-(chloromethyl)-4-(1-chloro-2,2,2-trifluoroethyl) |