2-amino-3-[(4-hydroxyphenyl)amino]propanoic acid structure
|
Common Name | 2-amino-3-[(4-hydroxyphenyl)amino]propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 80548-14-7 | Molecular Weight | 232.66400 | |
| Density | 1.411g/cm3 | Boiling Point | 484.4ºC at 760 mmHg | |
| Molecular Formula | C9H13ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.8ºC | |
| Name | 2-amino-3-(4-hydroxyanilino)propanoic acid,hydrochloride |
|---|
| Density | 1.411g/cm3 |
|---|---|
| Boiling Point | 484.4ºC at 760 mmHg |
| Molecular Formula | C9H13ClN2O3 |
| Molecular Weight | 232.66400 |
| Flash Point | 246.8ºC |
| Exact Mass | 232.06100 |
| PSA | 95.58000 |
| LogP | 1.79130 |
| Index of Refraction | 1.672 |
| InChIKey | JMHWWDULOHKOFJ-UHFFFAOYSA-N |
| SMILES | Cl.NC(CNc1ccc(O)cc1)C(=O)O |
|
~%
2-amino-3-[(4-h... CAS#:80548-14-7 |
| Literature: Lin; Kelley; Breitman; Driscoll Journal of Medicinal Chemistry, 1982 , vol. 25, # 5 p. 501 - 505 |
|
~%
2-amino-3-[(4-h... CAS#:80548-14-7 |
| Literature: Lin; Kelley; Breitman; Driscoll Journal of Medicinal Chemistry, 1982 , vol. 25, # 5 p. 501 - 505 |
|
~24%
2-amino-3-[(4-h... CAS#:80548-14-7 |
| Literature: Lin; Kelley; Breitman; Driscoll Journal of Medicinal Chemistry, 1982 , vol. 25, # 5 p. 501 - 505 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |