ethanol,trichloroiron,2,4,6-trinitrophenol structure
|
Common Name | ethanol,trichloroiron,2,4,6-trinitrophenol | ||
|---|---|---|---|---|
| CAS Number | 8055-05-8 | Molecular Weight | 437.37600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H9Cl3FeN3O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethanol,trichloroiron,2,4,6-trinitrophenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H9Cl3FeN3O8 |
|---|---|
| Molecular Weight | 437.37600 |
| Exact Mass | 435.88000 |
| PSA | 180.75000 |
| InChIKey | FFPRZNOIESDEQG-UHFFFAOYSA-K |
| SMILES | CCO.Cl[Fe](Cl)Cl.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| Phenol,2,4,6-trinitro-,mixt. with ethanol and iron chloride |
| Cervisol |