1(2H)-Naphthalenone, 3,4-dihydro-2-(1,3-benzodioxol-5-ylmethylene)
Modify Date: 2026-04-02 18:04:57
1(2H)-Naphthalenone, 3,4-dihydro-2-(1,3-benzodioxol-5-ylmethylene) structure
|
Common Name | 1(2H)-Naphthalenone, 3,4-dihydro-2-(1,3-benzodioxol-5-ylmethylene) | ||
|---|---|---|---|---|
| CAS Number | 80554-35-4 | Molecular Weight | 278.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1(2H)-Naphthalenone, 3,4-dihydro-2-(1,3-benzodioxol-5-ylmethylene) |
|---|
| Molecular Formula | C18H14O3 |
|---|---|
| Molecular Weight | 278.3 |
| InChIKey | ZSWFGLVDMKTZIO-NTEUORMPSA-N |
| SMILES | C1C/C(=C\C2=CC3=C(C=C2)OCO3)/C(=O)C4=CC=CC=C41 |
|
Name: Cell survival assay for modulators of telomere damage signalling
Source: 15378
Target: N/A
External Id: TELO_02
|
Total 1, Current Page 1 of 1
1