1-[(Z)-1-(4-nitrophenyl)-2-phenyl-ethenyl]pyridine
Modify Date: 2026-08-09 16:59:36
![1-[(Z)-1-(4-nitrophenyl)-2-phenyl-ethenyl]pyridine Structure](https://image.chemsrc.com/caspic/325/80561-30-4.png)
1-[(Z)-1-(4-nitrophenyl)-2-phenyl-ethenyl]pyridine structure
|
Common Name | 1-[(Z)-1-(4-nitrophenyl)-2-phenyl-ethenyl]pyridine | ||
|---|---|---|---|---|
| CAS Number | 80561-30-4 | Molecular Weight | 383.23900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H15BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[(Z)-1-(4-nitrophenyl)-2-phenylethenyl]pyridin-1-ium,bromide |
|---|
| Molecular Formula | C19H15BrN2O2 |
|---|---|
| Molecular Weight | 383.23900 |
| Exact Mass | 382.03200 |
| PSA | 49.70000 |
| LogP | 1.45590 |
| InChIKey | HJBOEEIIUHVBLJ-HVENRQQKSA-M |
| SMILES | O=[N+]([O-])c1ccc(C(=Cc2ccccc2)[n+]2ccccc2)cc1.[Br-] |
|
~%
1-[(Z)-1-(4-nit... CAS#:80561-30-4 |
| Literature: Kroehnke; Meyer-Delius Chemische Berichte, 1951 , vol. 84, p. 411,421 |
![1-[(4-nitrophenyl)methyl]pyridin-1-ium bromide structure](https://image.chemsrc.com/caspic/111/4329-73-1.png)
| Precursor 1 | |
|---|---|
| DownStream 2 | |
CAS#:4282-47-7
CAS#:3769-84-4|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1