4-amino-1-(2-diethylaminoethylamino)thioxanthen-9-one structure
|
Common Name | 4-amino-1-(2-diethylaminoethylamino)thioxanthen-9-one | ||
|---|---|---|---|---|
| CAS Number | 80568-02-1 | Molecular Weight | 341.47000 | |
| Density | 1.248g/cm3 | Boiling Point | 542.8ºC at 760 mmHg | |
| Molecular Formula | C19H23N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 282.1ºC | |
| Name | 4-amino-1-[2-(diethylamino)ethylamino]thioxanthen-9-one |
|---|
| Density | 1.248g/cm3 |
|---|---|
| Boiling Point | 542.8ºC at 760 mmHg |
| Molecular Formula | C19H23N3OS |
| Molecular Weight | 341.47000 |
| Flash Point | 282.1ºC |
| Exact Mass | 341.15600 |
| PSA | 86.60000 |
| LogP | 4.40480 |
| Index of Refraction | 1.675 |
| InChIKey | PQCVMZLKMPHEJJ-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNc1ccc(N)c2sc3ccccc3c(=O)c12 |
|
~%
4-amino-1-(2-di... CAS#:80568-02-1 |
| Literature: Archer, Sydney; Rej, Rabindra Journal of Medicinal Chemistry, 1982 , vol. 25, # 3 p. 328 - 331 |
|
~%
4-amino-1-(2-di... CAS#:80568-02-1 |
| Literature: Archer, Sydney; Rej, Rabindra Journal of Medicinal Chemistry, 1982 , vol. 25, # 3 p. 328 - 331 |
|
~%
4-amino-1-(2-di... CAS#:80568-02-1 |
| Literature: Archer, Sydney; Rej, Rabindra Journal of Medicinal Chemistry, 1982 , vol. 25, # 3 p. 328 - 331 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |