1-[2-(2-hydroxyethylamino)ethylamino]-4-nitro-thioxanthen-9-one structure
|
Common Name | 1-[2-(2-hydroxyethylamino)ethylamino]-4-nitro-thioxanthen-9-one | ||
|---|---|---|---|---|
| CAS Number | 80568-05-4 | Molecular Weight | 359.40000 | |
| Density | 1.442g/cm3 | Boiling Point | 639.2ºC at 760 mmHg | |
| Molecular Formula | C17H17N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 340.4ºC | |
| Name | 1-[2-(2-hydroxyethylamino)ethylamino]-4-nitrothioxanthen-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.442g/cm3 |
|---|---|
| Boiling Point | 639.2ºC at 760 mmHg |
| Molecular Formula | C17H17N3O4S |
| Molecular Weight | 359.40000 |
| Flash Point | 340.4ºC |
| Exact Mass | 359.09400 |
| PSA | 135.42000 |
| LogP | 3.30380 |
| Index of Refraction | 1.709 |
| InChIKey | FDVNAMGAICQFIR-UHFFFAOYSA-N |
| SMILES | O=c1c2ccccc2sc2c([N+](=O)[O-])ccc(NCCNCCO)c12 |
|
~%
1-[2-(2-hydroxy... CAS#:80568-05-4 |
| Literature: Archer, Sydney; Rej, Rabindra Journal of Medicinal Chemistry, 1982 , vol. 25, # 3 p. 328 - 331 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 9H-Thioxanthen-9-one,1-[[2-[(2-hydroxyethyl)amino]ethyl]amino]-4-nitro |
| 1-<<2-<(2-hydroxyethyl)amino>ethyl>amino>-4-nitrothioxanthenone |