4,6-dimethoxybenzene-1,3-disulfonyl chloride structure
|
Common Name | 4,6-dimethoxybenzene-1,3-disulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 80585-40-6 | Molecular Weight | 335.18200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8Cl2O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,6-dimethoxybenzene-1,3-disulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H8Cl2O6S2 |
|---|---|
| Molecular Weight | 335.18200 |
| Exact Mass | 333.91400 |
| PSA | 103.50000 |
| LogP | 3.72040 |
| InChIKey | SDKJJAKGOABBBD-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c(S(=O)(=O)Cl)cc1S(=O)(=O)Cl |
|
~95%
4,6-dimethoxybe... CAS#:80585-40-6 |
| Literature: Sekine, Mitsuo; Matsuzaki, Jun-ichi; Hata, Tsujiaki Tetrahedron Letters, 1981 , vol. 22, # 33 p. 3209 - 3212 |
|
~10%
4,6-dimethoxybe... CAS#:80585-40-6 |
| Literature: Sekine, Mitsuo; Matsuzaki, Jun-Ichi; Hata, Tsujiaki Tetrahedron, 1985 , vol. 41, # 22 p. 5279 - 5288 |
|
~%
4,6-dimethoxybe... CAS#:80585-40-6 |
| Literature: Cremlyn,R.J.W.; Hornby,R. Journal of the Chemical Society [Section] C: Organic, 1969 , p. 1341 - 1345 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 4,6-Dimethoxy-benzol-1,3-disulfonylchlorid |
| 1,3-Benzenedisulfonyl dichloride,4,6-dimethoxy |
| 2,4-dimethoxybenzene-1,5-disulfonyl chloride |
| 4,6-dimethoxy-1,3-benzenedisulfonyl chloride |
| 4,6-dimethoxybenzene-1,3-disulphonyl chloride |
| 4,6-dimethoxybenzene-1,3-disulfonyl dichloride |
| 4,6-dimethoxy-benzene-1,3-disulfonyl chloride |