sodium,1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate,1,8-dihydroxyanthracene-9,10-dione structure
|
Common Name | sodium,1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate,1,8-dihydroxyanthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 8059-64-1 | Molecular Weight | 684.76900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H45NaO11S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sodium,1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate,1,8-dihydroxyanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C34H45NaO11S |
|---|---|
| Molecular Weight | 684.76900 |
| Exact Mass | 684.25800 |
| PSA | 192.78000 |
| LogP | 6.76350 |
| InChIKey | CMXPERZAMAQXSF-UHFFFAOYSA-M |
| SMILES | CCCCC(CC)COC(=O)CC(C(=O)OCC(CC)CCCC)S(=O)(=O)[O-].O=C1c2cccc(O)c2C(=O)c2c(O)cccc21.[Na+] |
| Solven |
| DSS-danthron |
| sodium 1,4-bis[(2-ethylhexyl)oxy]-1,4-dioxobutane-2-sulfonate-1,8-dihydroxyanthracene-9,10-dione (1:1:1) |
| Butanedioic acid,sulfo-,1,4-bis(2-ethylhexyl)ester,sodium salt,mixt. with 1,8-dihydroxy-9,10-anthracenedione |
| Anthraquinone,1,8-dihydroxy-,mixed with bis(2-ethylhexyl) 2-sulfosuccinate sodium salt |
| Jamylene |