7-chloro-6-(dimethylamino)-2-phenylpyrano[3,2-g][1,3]benzothiazol-8-one structure
|
Common Name | 7-chloro-6-(dimethylamino)-2-phenylpyrano[3,2-g][1,3]benzothiazol-8-one | ||
|---|---|---|---|---|
| CAS Number | 80616-37-1 | Molecular Weight | 356.82600 | |
| Density | 1.46g/cm3 | Boiling Point | 533.4ºC at 760 mmHg | |
| Molecular Formula | C18H13ClN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 276.4ºC | |
| Name | 7-chloro-6-(dimethylamino)-2-phenylpyrano[3,2-g][1,3]benzothiazol-8-one |
|---|
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 533.4ºC at 760 mmHg |
| Molecular Formula | C18H13ClN2O2S |
| Molecular Weight | 356.82600 |
| Flash Point | 276.4ºC |
| Exact Mass | 356.03900 |
| PSA | 74.58000 |
| LogP | 4.78910 |
| Index of Refraction | 1.721 |
| InChIKey | POMFUZJCZBRCNH-UHFFFAOYSA-N |
| SMILES | CN(C)c1c(Cl)c(=O)oc2c1ccc1nc(-c3ccccc3)sc12 |
|
~20%
7-chloro-6-(dim... CAS#:80616-37-1 |
| Literature: Mosti, Luisa; Menozzi, Giulia; Schenone, Pietro Journal of Heterocyclic Chemistry, 1981 , vol. 18, p. 1263 - 1267 |
|
~%
7-chloro-6-(dim... CAS#:80616-37-1 |
| Literature: Mosti, Luisa; Menozzi, Giulia; Schenone, Pietro Journal of Heterocyclic Chemistry, 1981 , vol. 18, p. 1263 - 1267 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |