ethyl 2-(2-(pyridin-4-yl)thiazol-4-yl)acetate
ethyl 2-(2-(pyridin-4-yl)thiazol-4-yl)acetate structure
|
Common Name | ethyl 2-(2-(pyridin-4-yl)thiazol-4-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 80653-68-5 | Molecular Weight | 248.30100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 2-(2-(pyridin-4-yl)thiazol-4-yl)acetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H12N2O2S |
|---|---|
| Molecular Weight | 248.30100 |
| Exact Mass | 248.06200 |
| PSA | 80.32000 |
| LogP | 2.31070 |
| InChIKey | JZBJUBBYJUUKQK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1csc(-c2ccncc2)n1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:80653-76-5This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of ethyl 2-(2-(pyridin-4-yl)thiazol-4-yl)acetate? |
| A: Related downstream products(CAS) of ethyl 2-(2-(pyridin-4-yl)thiazol-4-yl)acetate: 80653-76-5. |
| Q: What is the molecular weight of ethyl 2-(2-(pyridin-4-yl)thiazol-4-yl)acetate? |
| A: Molecular weight of ethyl 2-(2-(pyridin-4-yl)thiazol-4-yl)acetate is 248.30100. |
| Q: What is the polar surface area (PSA) of ethyl 2-(2-(pyridin-4-yl)thiazol-4-yl)acetate? |
| A: Polar surface area (PSA) of ethyl 2-(2-(pyridin-4-yl)thiazol-4-yl)acetate is 80.32000. |
| Q: What is the SMILES notation of ethyl 2-(2-(pyridin-4-yl)thiazol-4-yl)acetate? |
| A: SMILES notation of ethyl 2-(2-(pyridin-4-yl)thiazol-4-yl)acetate is CCOC(=O)Cc1csc(-c2ccncc2)n1. |
| Q: What is the molecular formula of ethyl 2-(2-(pyridin-4-yl)thiazol-4-yl)acetate? |
| A: Molecular formula of ethyl 2-(2-(pyridin-4-yl)thiazol-4-yl)acetate is C12H12N2O2S. |
| Q: What is the LogP of ethyl 2-(2-(pyridin-4-yl)thiazol-4-yl)acetate? |
| A: LogP of ethyl 2-(2-(pyridin-4-yl)thiazol-4-yl)acetate is 2.31070. |
| Q: What is the InChIKey of ethyl 2-(2-(pyridin-4-yl)thiazol-4-yl)acetate? |
| A: InChIKey of ethyl 2-(2-(pyridin-4-yl)thiazol-4-yl)acetate is JZBJUBBYJUUKQK-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 80653-68-5? |
| A: Chinese name of 80653-68-5 is 80653-68-5. |
| Q: What is the CAS number of ethyl 2-(2-(pyridin-4-yl)thiazol-4-yl)acetate? |
| A: CAS number of ethyl 2-(2-(pyridin-4-yl)thiazol-4-yl)acetate is 80653-68-5. |
| Q: What is the English name of ethyl 2-(2-(pyridin-4-yl)thiazol-4-yl)acetate? |
| A: The English name of ethyl 2-(2-(pyridin-4-yl)thiazol-4-yl)acetate is ethyl 2-(2-(pyridin-4-yl)thiazol-4-yl)acetate. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |