ZEAPRIMDKV30 structure
|
Common Name | ZEAPRIMDKV30 | ||
|---|---|---|---|---|
| CAS Number | 8066-10-2 | Molecular Weight | 457.04000 | |
| Density | N/A | Boiling Point | 401.1ºC at 760 mmHg | |
| Molecular Formula | C18H33ClN10S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.4ºC | |
| Name | 2-N-tert-butyl-4-N-ethyl-6-methylsulfanyl-1,3,5-triazine-2,4-diamine,6-chloro-4-N-ethyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 401.1ºC at 760 mmHg |
|---|---|
| Molecular Formula | C18H33ClN10S |
| Molecular Weight | 457.04000 |
| Flash Point | 196.4ºC |
| Exact Mass | 456.23000 |
| PSA | 160.45000 |
| LogP | 2.35150 |
| InChIKey | OMAXYPGVUGYYGN-UHFFFAOYSA-N |
| SMILES | CCNc1nc(Cl)nc(NC(C)C)n1.CCNc1nc(NC(C)(C)C)nc(SC)n1 |
| Zeazin-igran mixt |
| Aterbutox 20/20 |
| 1,3,5-Triazine-2,4-diamine,6-chloro-N-ethyl-N'-(1-methylethyl)-,mixed with N-(1,1-dimethylethyl)-N'-ethyl-6-(methylthio)-1,3,5-triazine-2,4-diamine |
| Zeaprim DKV 30 |
| Vuagt 313 |
| Atrazine mixture with terbutryn |
| Atrazine-terbutryn mixture |
| A 3666 |
| Gesaprim combi |