but-3-yn-2-yl N-(3-chlorophenyl)carbamate,3-cyclooctyl-1,1-dimethylurea,methyl (methoxycarbonyldisulfanyl)formate structure
|
Common Name | but-3-yn-2-yl N-(3-chlorophenyl)carbamate,3-cyclooctyl-1,1-dimethylurea,methyl (methoxycarbonyldisulfanyl)formate | ||
|---|---|---|---|---|
| CAS Number | 8066-54-4 | Molecular Weight | 604.17900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H38ClN3O7S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | but-3-yn-2-yl N-(3-chlorophenyl)carbamate,3-cyclooctyl-1,1-dimethylurea,methyl (methoxycarbonyldisulfanyl)formate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C26H38ClN3O7S2 |
|---|---|
| Molecular Weight | 604.17900 |
| Exact Mass | 603.18400 |
| PSA | 180.85000 |
| LogP | 7.39930 |
| InChIKey | RQIDEQIHXGRYBG-UHFFFAOYSA-N |
| SMILES | C#CC(C)OC(=O)Nc1cccc(Cl)c1.CN(C)C(=O)NC1CCCCCCC1.COC(=O)SSC(=O)OC |
| RS 17 |
| Thioperoxydicarbonic acid,dimethyl ester,mixt. with N'-cyclooctyl-N,N-dimethylurea and 1-methyl-2-propynyl (3-chlorophenyl)carbamate |