Benoram
Modify Date: 2025-09-11 22:53:21
Benoram structure
|
Common Name | Benoram | ||
|---|---|---|---|---|
| CAS Number | 8068-35-7 | Molecular Weight | 498.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H30N6O5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benoram |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H30N6O5S2 |
|---|---|
| Molecular Weight | 498.6 |
| InChIKey | BCVNCJWDDOITBB-UHFFFAOYSA-N |
| SMILES | CCCCNC(=O)n1c(NC(=O)OC)nc2ccccc21.CN(C)C(=O)SSC(=O)N(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Benoram? |
| A: InChIKey of Benoram is BCVNCJWDDOITBB-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Benoram? |
| A: SMILES notation of Benoram is CCCCNC(=O)n1c(NC(=O)OC)nc2ccccc21.CN(C)C(=O)SSC(=O)N(C)C. |
| Q: What is the Chinese name of 8068-35-7? |
| A: Chinese name of 8068-35-7 is 8068-35-7. |
| Q: What is the molecular weight of Benoram? |
| A: Molecular weight of Benoram is 498.6. |
| Q: What is the English name of Benoram? |
| A: The English name of Benoram is Benoram. |
| Q: What is the molecular formula of Benoram? |
| A: Molecular formula of Benoram is C20H30N6O5S2. |
| Q: What is the CAS number of Benoram? |
| A: CAS number of Benoram is 8068-35-7. |