6-chloro-4-N-ethyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine,S-ethyl N,N-bis(2-methylpropyl)carbamothioate structure
|
Common Name | 6-chloro-4-N-ethyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine,S-ethyl N,N-bis(2-methylpropyl)carbamothioate | ||
|---|---|---|---|---|
| CAS Number | 8070-81-3 | Molecular Weight | 433.05500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H37ClN6OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-chloro-4-N-ethyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine,S-ethyl N,N-bis(2-methylpropyl)carbamothioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H37ClN6OS |
|---|---|
| Molecular Weight | 433.05500 |
| Exact Mass | 432.24400 |
| PSA | 114.80000 |
| LogP | 4.09440 |
| InChIKey | XCZUPUWVWLOZQF-UHFFFAOYSA-N |
| SMILES | CCNc1nc(Cl)nc(NC(C)C)n1.CCSC(=O)N(CC(C)C)CC(C)C |
| Carbamothioic acid,bis(2-methylpropyl)-,S-ethyl ester,mixt. with 6-chloro-N-ethyl-N'-(1-methylethyl)-1,3,5-triazine-2,4-diamine |
| Atrazine-butylate mixture |
| Atrazine mixture with butylate |