6-chloro-4-N-cyclopropyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine,S-ethyl N,N-diethylcarbamothioate structure
|
Common Name | 6-chloro-4-N-cyclopropyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine,S-ethyl N,N-diethylcarbamothioate | ||
|---|---|---|---|---|
| CAS Number | 8071-40-7 | Molecular Weight | 388.95900 | |
| Density | N/A | Boiling Point | 399ºC at 760 mmHg | |
| Molecular Formula | C16H29ClN6OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.1ºC | |
| Name | 6-chloro-4-N-cyclopropyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine,S-ethyl N,N-diethylcarbamothioate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 399ºC at 760 mmHg |
|---|---|
| Molecular Formula | C16H29ClN6OS |
| Molecular Weight | 388.95900 |
| Flash Point | 195.1ºC |
| Exact Mass | 388.18100 |
| PSA | 114.80000 |
| LogP | 2.96470 |
| InChIKey | GDNFGRAJXOKRJW-UHFFFAOYSA-N |
| SMILES | CC(C)Nc1nc(Cl)nc(NC2CC2)n1.CCSC(=O)N(CC)CC |
| Cyprazine mixt. with ethiolate |
| S 6176 |
| Etiolate |
| Carbamic acid,diethylthio-,S-ethyl ester,mixed with 2-chloro-4-cyclopropylamino-6-isopropylamino-s-triazine |
| Prefox |