bis(2,2-dimethylpropyl) phenyl phosphite structure
|
Common Name | bis(2,2-dimethylpropyl) phenyl phosphite | ||
|---|---|---|---|---|
| CAS Number | 80733-03-5 | Molecular Weight | 298.35800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H27O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(2,2-dimethylpropyl) phenyl phosphite |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H27O3P |
|---|---|
| Molecular Weight | 298.35800 |
| Exact Mass | 298.17000 |
| PSA | 41.28000 |
| LogP | 5.41770 |
| InChIKey | GOJNKTSUNQIUCX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)COP(OCC(C)(C)C)Oc1ccccc1 |
|
~80%
bis(2,2-dimethy... CAS#:80733-03-5 |
| Literature: Hudson, Harry R.; Kow, Aloysius; Roberts, John C. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1983 , # 9 p. 1363 - 1368 |
| Precursor 2 | |
|---|---|
| DownStream 9 | |
| Phosphorous acid,bis(2,2-dimethylpropyl) phenyl ester |
| dineopentyl phenyl phosphite |