buta-1,3-dien-2-yloxy-tert-butyl-dimethylsilane
buta-1,3-dien-2-yloxy-tert-butyl-dimethylsilane structure
|
Common Name | buta-1,3-dien-2-yloxy-tert-butyl-dimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 80738-05-2 | Molecular Weight | 184.35100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H20OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | buta-1,3-dien-2-yloxy-tert-butyl-dimethylsilane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H20OSi |
|---|---|
| Molecular Weight | 184.35100 |
| Exact Mass | 184.12800 |
| PSA | 9.23000 |
| LogP | 3.70790 |
| InChIKey | BMTBAMFIDWUEMA-UHFFFAOYSA-N |
| SMILES | C=CC(=C)O[Si](C)(C)C(C)(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
buta-1,3-dien-2... CAS#:80738-05-2 |
| Literature: Beifuss, Uwe; Gehm, Henning; Noltemeyer, Mathias; Schmidt, Hans-Georg Angewandte Chemie, 1995 , vol. 107, # 6 p. 705 - 707 |
|
~%
buta-1,3-dien-2... CAS#:80738-05-2 |
| Literature: Kirmse, Wolfgang; Mrotzeck, Uwe Chemische Berichte, 1988 , vol. 121, p. 485 - 492 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 1 | |
CAS#:143106-12-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-(tert-Butyldimethylsilyloxy)-1,3-butadien |
| 2-<<(tert-butyl)dimethylsilyl>oxy>buta-1,3-diene |
| 2-<<dimethyl(1,1-dimethylethyl)silyl>oxy>-1,3-butadiene |
| 2-<(tert-butyldimethylsilyl)oxy>-1,3-butadiene |
| Silane,(1,1-dimethylethyl)dimethyl[(1-methylene-2-propenyl)oxy] |
| 2-(tert-butyldimethylsiloxy)-1,3-butadiene |
| tert-Butyl(dimethyl)[(1-methylene-2-propenyl)oxy]silane |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of buta-1,3-dien-2-yloxy-tert-butyl-dimethylsilane? |
| A: The English name of buta-1,3-dien-2-yloxy-tert-butyl-dimethylsilane is buta-1,3-dien-2-yloxy-tert-butyl-dimethylsilane. |
| Q: What is the polar surface area (PSA) of buta-1,3-dien-2-yloxy-tert-butyl-dimethylsilane? |
| A: Polar surface area (PSA) of buta-1,3-dien-2-yloxy-tert-butyl-dimethylsilane is 9.23000. |
| Q: What are the downstream products of buta-1,3-dien-2-yloxy-tert-butyl-dimethylsilane? |
| A: Related downstream products(CAS) of buta-1,3-dien-2-yloxy-tert-butyl-dimethylsilane: 143106-12-1. |
| Q: What is the molecular formula of buta-1,3-dien-2-yloxy-tert-butyl-dimethylsilane? |
| A: Molecular formula of buta-1,3-dien-2-yloxy-tert-butyl-dimethylsilane is C10H20OSi. |
| Q: What is the LogP of buta-1,3-dien-2-yloxy-tert-butyl-dimethylsilane? |
| A: LogP of buta-1,3-dien-2-yloxy-tert-butyl-dimethylsilane is 3.70790. |
| Q: What English synonyms does buta-1,3-dien-2-yloxy-tert-butyl-dimethylsilane have? |
| A: English synonyms of buta-1,3-dien-2-yloxy-tert-butyl-dimethylsilane: 2-(tert-Butyldimethylsilyloxy)-1,3-butadien, 2- |
| Q: What is the molecular weight of buta-1,3-dien-2-yloxy-tert-butyl-dimethylsilane? |
| A: Molecular weight of buta-1,3-dien-2-yloxy-tert-butyl-dimethylsilane is 184.35100. |
| Q: What is the Chinese name of 80738-05-2? |
| A: Chinese name of 80738-05-2 is 80738-05-2. |
| Q: What is the SMILES notation of buta-1,3-dien-2-yloxy-tert-butyl-dimethylsilane? |
| A: SMILES notation of buta-1,3-dien-2-yloxy-tert-butyl-dimethylsilane is C=CC(=C)O[Si](C)(C)C(C)(C)C. |
| Q: What is the InChIKey of buta-1,3-dien-2-yloxy-tert-butyl-dimethylsilane? |
| A: InChIKey of buta-1,3-dien-2-yloxy-tert-butyl-dimethylsilane is BMTBAMFIDWUEMA-UHFFFAOYSA-N. |