2-butan-2-yl-4,6-dinitrophenol,2-(naphthalen-1-ylcarbamoyl)benzoic acid structure
|
Common Name | 2-butan-2-yl-4,6-dinitrophenol,2-(naphthalen-1-ylcarbamoyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 8075-57-8 | Molecular Weight | 531.51300 | |
| Density | N/A | Boiling Point | 450.8ºC at 760 mmHg | |
| Molecular Formula | C28H25N3O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.4ºC | |
| Name | 2-butan-2-yl-4,6-dinitrophenol,2-(naphthalen-1-ylcarbamoyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 450.8ºC at 760 mmHg |
|---|---|
| Molecular Formula | C28H25N3O8 |
| Molecular Weight | 531.51300 |
| Flash Point | 226.4ºC |
| Exact Mass | 531.16400 |
| PSA | 181.76000 |
| LogP | 7.94280 |
| InChIKey | NYUFRUQFEVCILT-UHFFFAOYSA-N |
| SMILES | CCC(C)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O.O=C(O)c1ccccc1C(=O)Nc1cccc2ccccc12 |
| 2-((1-Naphthalenylamino)carbonyl)benzoic acid mixt. with 2-(1-methylpropyl)-4,6-dinitrophenol |
| Benzoic acid,2-((1-naphthalenylamino)carbonyl)-,mixt. with 2-(1-methylpropyl)-4,6-dinitrophenol |
| Naptalam mixt. with dinoseb |