4-Nitrophenyl (1-methylethyl)phenylphosphinate
4-Nitrophenyl (1-methylethyl)phenylphosphinate structure
|
Common Name | 4-Nitrophenyl (1-methylethyl)phenylphosphinate | ||
|---|---|---|---|---|
| CAS Number | 80751-39-9 | Molecular Weight | 305.26600 | |
| Density | 1.25g/cm3 | Boiling Point | 432.9ºC at 760 mmHg | |
| Molecular Formula | C15H16NO4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.6ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-nitro-4-[phenyl(propan-2-yl)phosphoryl]oxybenzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 432.9ºC at 760 mmHg |
| Molecular Formula | C15H16NO4P |
| Molecular Weight | 305.26600 |
| Flash Point | 215.6ºC |
| Exact Mass | 305.08200 |
| PSA | 81.93000 |
| LogP | 4.50880 |
| Index of Refraction | 1.568 |
| InChIKey | OUZVRLZAQUEQAZ-UHFFFAOYSA-N |
| SMILES | CC(C)P(=O)(Oc1ccc([N+](=O)[O-])cc1)c1ccccc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:16543-43-4
CAS#:824-78-2
CAS#:14609-74-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Nitrophenyl (1-methylethyl)phenylphosphinate |
| Phosphinic acid,(1-methylethyl)phenyl-,4-nitrophenyl ester |
| Phosphinic acid,(1-methylethyl)phenyl-,4-nitrophenyl ester (9CI) |
| (ISOPROPYL)PHENYLPHOSPHINIC ACID 4-NITROPHENYL ESTER |
| 4-Nitrophenylisopropylphenylphosphinate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 1-nitro-4-[phenyl(propan-2-yl)phosphoryl]oxybenzene have? |
| A: English synonyms of 1-nitro-4-[phenyl(propan-2-yl)phosphoryl]oxybenzene: 4-Nitrophenyl (1-methylethyl)phenylphosphinate, Phosphinic acid,(1-methylethyl)phenyl-,4-nitrophenyl ester, Phosphinic acid,(1-methylethyl)phenyl-,4-nitrophenyl ester (9CI), (ISOPROPYL)PHENYLPHOSPHINIC ACID 4-NITROPHENYL ESTER, 4-Nitrophenylisopropylphenylphosphinate. |
| Q: What is the polar surface area (PSA) of 1-nitro-4-[phenyl(propan-2-yl)phosphoryl]oxybenzene? |
| A: Polar surface area (PSA) of 1-nitro-4-[phenyl(propan-2-yl)phosphoryl]oxybenzene is 81.93000. |
| Q: What is the InChIKey of 1-nitro-4-[phenyl(propan-2-yl)phosphoryl]oxybenzene? |
| A: InChIKey of 1-nitro-4-[phenyl(propan-2-yl)phosphoryl]oxybenzene is OUZVRLZAQUEQAZ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 80751-39-9? |
| A: Chinese name of 80751-39-9 is 80751-39-9. |
| Q: What is the molecular formula of 1-nitro-4-[phenyl(propan-2-yl)phosphoryl]oxybenzene? |
| A: Molecular formula of 1-nitro-4-[phenyl(propan-2-yl)phosphoryl]oxybenzene is C15H16NO4P. |
| Q: What is the boiling point of 1-nitro-4-[phenyl(propan-2-yl)phosphoryl]oxybenzene? |
| A: Boiling point of 1-nitro-4-[phenyl(propan-2-yl)phosphoryl]oxybenzene is 432.9ºC at 760 mmHg. |
| Q: What is the CAS number of 1-nitro-4-[phenyl(propan-2-yl)phosphoryl]oxybenzene? |
| A: CAS number of 1-nitro-4-[phenyl(propan-2-yl)phosphoryl]oxybenzene is 80751-39-9. |
| Q: What is the English name of 1-nitro-4-[phenyl(propan-2-yl)phosphoryl]oxybenzene? |
| A: The English name of 1-nitro-4-[phenyl(propan-2-yl)phosphoryl]oxybenzene is 1-nitro-4-[phenyl(propan-2-yl)phosphoryl]oxybenzene. |
| Q: What is the molecular weight of 1-nitro-4-[phenyl(propan-2-yl)phosphoryl]oxybenzene? |
| A: Molecular weight of 1-nitro-4-[phenyl(propan-2-yl)phosphoryl]oxybenzene is 305.26600. |
| Q: What are the downstream products of 1-nitro-4-[phenyl(propan-2-yl)phosphoryl]oxybenzene? |
| A: Related downstream products(CAS) of 1-nitro-4-[phenyl(propan-2-yl)phosphoryl]oxybenzene: 16543-43-4;824-78-2;14609-74-6. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |