1,3-Benzodioxole,5,5'-(1,2-ethanediyl)bis
1,3-Benzodioxole,5,5'-(1,2-ethanediyl)bis structure
|
Common Name | 1,3-Benzodioxole,5,5'-(1,2-ethanediyl)bis | ||
|---|---|---|---|---|
| CAS Number | 80784-19-6 | Molecular Weight | 270.28000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-[2-(1,3-benzodioxol-5-yl)ethyl]-1,3-benzodioxole |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H14O4 |
|---|---|
| Molecular Weight | 270.28000 |
| Exact Mass | 270.08900 |
| PSA | 36.92000 |
| LogP | 2.92920 |
| InChIKey | SEWUIZYKFWMKTO-UHFFFAOYSA-N |
| SMILES | c1cc2c(cc1CCc1ccc3c(c1)OCO3)OCO2 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
![5-[2-(1,3-benzodioxol-5-yl)ethenyl]-1,3-benzodioxole structure](https://image.chemsrc.com/caspic/214/51626-97-2.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 1 | |
CAS#:222-38-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3,3,3',4'-dimethylenedioxybibenzyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 5-[2-(1,3-benzodioxol-5-yl)ethyl]-1,3-benzodioxole? |
| A: Molecular weight of 5-[2-(1,3-benzodioxol-5-yl)ethyl]-1,3-benzodioxole is 270.28000. |
| Q: What is the Chinese name of 80784-19-6? |
| A: Chinese name of 80784-19-6 is 80784-19-6. |
| Q: What is the molecular formula of 5-[2-(1,3-benzodioxol-5-yl)ethyl]-1,3-benzodioxole? |
| A: Molecular formula of 5-[2-(1,3-benzodioxol-5-yl)ethyl]-1,3-benzodioxole is C16H14O4. |
| Q: What is the SMILES notation of 5-[2-(1,3-benzodioxol-5-yl)ethyl]-1,3-benzodioxole? |
| A: SMILES notation of 5-[2-(1,3-benzodioxol-5-yl)ethyl]-1,3-benzodioxole is c1cc2c(cc1CCc1ccc3c(c1)OCO3)OCO2. |
| Q: What is the CAS number of 5-[2-(1,3-benzodioxol-5-yl)ethyl]-1,3-benzodioxole? |
| A: CAS number of 5-[2-(1,3-benzodioxol-5-yl)ethyl]-1,3-benzodioxole is 80784-19-6. |
| Q: What are the downstream products of 5-[2-(1,3-benzodioxol-5-yl)ethyl]-1,3-benzodioxole? |
| A: Related downstream products(CAS) of 5-[2-(1,3-benzodioxol-5-yl)ethyl]-1,3-benzodioxole: 222-38-8. |
| Q: What is the InChIKey of 5-[2-(1,3-benzodioxol-5-yl)ethyl]-1,3-benzodioxole? |
| A: InChIKey of 5-[2-(1,3-benzodioxol-5-yl)ethyl]-1,3-benzodioxole is SEWUIZYKFWMKTO-UHFFFAOYSA-N. |
| Q: What is the LogP of 5-[2-(1,3-benzodioxol-5-yl)ethyl]-1,3-benzodioxole? |
| A: LogP of 5-[2-(1,3-benzodioxol-5-yl)ethyl]-1,3-benzodioxole is 2.92920. |
| Q: What English synonyms does 5-[2-(1,3-benzodioxol-5-yl)ethyl]-1,3-benzodioxole have? |
| A: English synonyms of 5-[2-(1,3-benzodioxol-5-yl)ethyl]-1,3-benzodioxole: 3,3,3',4'-dimethylenedioxybibenzyl. |
| Q: What is the polar surface area (PSA) of 5-[2-(1,3-benzodioxol-5-yl)ethyl]-1,3-benzodioxole? |
| A: Polar surface area (PSA) of 5-[2-(1,3-benzodioxol-5-yl)ethyl]-1,3-benzodioxole is 36.92000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |