2H-1,3,5-Thiadiazine-2,4(3H)-dione,6-[4-(dimethylamino)phenyl]- structure
|
Common Name | 2H-1,3,5-Thiadiazine-2,4(3H)-dione,6-[4-(dimethylamino)phenyl]- | ||
|---|---|---|---|---|
| CAS Number | 80784-83-4 | Molecular Weight | 249.28900 | |
| Density | 1.38g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H11N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-[4-(dimethylamino)phenyl]-1,3,5-thiadiazine-2,4-dione |
|---|
| Density | 1.38g/cm3 |
|---|---|
| Molecular Formula | C11H11N3O2S |
| Molecular Weight | 249.28900 |
| Exact Mass | 249.05700 |
| PSA | 94.30000 |
| LogP | 0.92460 |
| Index of Refraction | 1.67 |
| InChIKey | QYPZHYAJLJYXIX-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(-c2nc(=O)[nH]c(=O)s2)cc1 |
|
~76%
2H-1,3,5-Thiadi... CAS#:80784-83-4 |
| Literature: Coburn; Ho; Bronstein Journal of Medicinal Chemistry, 1982 , vol. 25, # 4 p. 481 - 483 |
|
~%
2H-1,3,5-Thiadi... CAS#:80784-83-4 |
| Literature: Coburn; Ho; Bronstein Journal of Medicinal Chemistry, 1982 , vol. 25, # 4 p. 481 - 483 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |