(6'-methyl-10'-oxospiro[1,3-dioxolane-2,3'-bicyclo[4.3.1]decane]-7'-yl) acetate structure
|
Common Name | (6'-methyl-10'-oxospiro[1,3-dioxolane-2,3'-bicyclo[4.3.1]decane]-7'-yl) acetate | ||
|---|---|---|---|---|
| CAS Number | 80800-92-6 | Molecular Weight | 282.33200 | |
| Density | 1.2g/cm3 | Boiling Point | 391.6ºC at 760 mmHg | |
| Molecular Formula | C15H22O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.8ºC | |
| Name | (6'-methyl-10'-oxospiro[1,3-dioxolane-2,3'-bicyclo[4.3.1]decane]-7'-yl) acetate |
|---|
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 391.6ºC at 760 mmHg |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.33200 |
| Flash Point | 201.8ºC |
| Exact Mass | 282.14700 |
| PSA | 61.83000 |
| LogP | 1.83050 |
| Index of Refraction | 1.516 |
| InChIKey | RNLFOJQICKUPPM-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1CCC2CC3(CCC1(C)C2=O)OCCO3 |
|
~80%
(6'-methyl-10'-... CAS#:80800-92-6 |
| Literature: Heathcock; DelMar; Graham Journal of the American Chemical Society, 1982 , vol. 104, # 7 p. 1907 - 1917 |
|
~%
(6'-methyl-10'-... CAS#:80800-92-6 |
| Literature: Heathcock; DelMar; Graham Journal of the American Chemical Society, 1982 , vol. 104, # 7 p. 1907 - 1917 |
|
~%
(6'-methyl-10'-... CAS#:80800-92-6 |
| Literature: Heathcock; DelMar; Graham Journal of the American Chemical Society, 1982 , vol. 104, # 7 p. 1907 - 1917 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |