2-[2,3-dibromo-7-ethyl-4-(4-ethylphenyl)naphthalen-1-yl]oxyacetic acid structure
|
Common Name | 2-[2,3-dibromo-7-ethyl-4-(4-ethylphenyl)naphthalen-1-yl]oxyacetic acid | ||
|---|---|---|---|---|
| CAS Number | 80826-08-0 | Molecular Weight | 492.20000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H20Br2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[2,3-dibromo-7-ethyl-4-(4-ethylphenyl)naphthalen-1-yl]oxyacetic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H20Br2O3 |
|---|---|
| Molecular Weight | 492.20000 |
| Exact Mass | 489.97800 |
| PSA | 46.53000 |
| LogP | 6.62000 |
| InChIKey | GRNPBYPVTQIEJT-UHFFFAOYSA-N |
| SMILES | CCc1ccc(-c2c(Br)c(Br)c(OCC(=O)O)c3cc(CC)ccc23)cc1 |
|
~69%
2-[2,3-dibromo-... CAS#:80826-08-0 |
| Literature: Krepelka, Jiri; Roubik, Jiri; Holubek, Jiri Collection of Czechoslovak Chemical Communications, 1981 , vol. 46, # 9 p. 2116 - 2122 |
|
~%
2-[2,3-dibromo-... CAS#:80826-08-0 |
| Literature: Krepelka, Jiri; Roubik, Jiri; Holubek, Jiri Collection of Czechoslovak Chemical Communications, 1981 , vol. 46, # 9 p. 2116 - 2122 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Acetic acid,[[2,3-dibromo-7-ethyl-4-(4-ethylphenyl)-1-naphthalenyl]oxy] |